|
|
Year of first isolation: |
1988 |
Formula: | C27H45O8P |
Molecular weight: | 528 |
Occurence in plants: |
|
Occurence in animals: |
Bombyx mori [Bombycidae] »
|
|
| |
Canonical SMILES | CC12CCC(CC1(C(C=C3C2CCC4(C3=CCC4C(C)(CCCC(C)(C)O)O)C)O)O)OP(=O)(O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@](C[C@H](C1)OP(=O)([O-])[O-])([C@H](C=C1[C@@H]2CC[C@]2(C1=CC[C@@H]2[C@](C)(CCCC(C)(C)O)O)C)O)O)C »
| IUPAC Name | [(3S,5R,6S,10R,13R,17S)-17-[(2R)-2,6-dihydroxy-6-methylheptan-2-yl]-5,6-dihydroxy-10,13-dimethyl-1,2,3,4,6,9,11,12,16,17-decahydrocyclopenta[a]phenanthren-3-yl] dihydrogen phosphate | CAS-RN | 117176-38-2 | PubChem CID | 11466693 | InChiKey [ ChemIDPlus: search ] | UBFMELJDOQTPRP-LKXQFJSNSA-N | InChI | InChI=1S/C27H45O8P/c1-23(2,29)11-6-12-26(5,30)21-8-7-19-18-15-22(28)27(31)16-17(35-36(32,33)34)9-14-25(27,4)20(18)10-13-24(19,21)3/h7,15,17,20-22,28-31H,6,8-14,16H2,1-5H3,(H2,32,33,34)/t17-,20?,21-,22-,24-,25+,26+,27-/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | FAB-MS m/z | 527 (M-H)- | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CD3OD | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-He | 4.40 (m ) | 04-Ha | | 04-He | | 06-H | 3.87 (m ) | 07-H | 5.52 (m ) | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-H | 5.63 (m ) | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.958 (s ) | 19-Me | 1.007 (s ) | 21-Me | 1.273 (s ) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.173 (s ) | 27-Me | 1.173 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | RP-HPLC, Column Whatman ODS-3 Magnum 9 (250 mm long, 9.4 mm i.d.) eluted with a linear gradient (30 min) of methanol from 5:95 to 7:3 (v/v) flow-rate 3 ml.min-1, Ret 27.5 min. |
| |
| |
|
Permanent link to this datasheet: BOMBYCOSTEROL 3-PHOSPHATE
|
|