|
|
Year of first isolation: |
1995 |
Formula: | C31H46O9 |
Molecular weight: | 562 |
Occurence in plants: |
Ajuga reptans var. atropurpurea [Lamiaceae (alt. Labiatae)] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)OC(=O)C)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](C[C@@H]1[C@H](OC(=O)[C@H]1C)C)O)O)O)C)C » 
| IUPAC Name | | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | WXZKWXBGILJBMI-UVORWOJQSA-N | InChI | InChI=1S/C31H46O9/c1-15-18(16(2)39-27(15)36)11-26(35)30(6,37)25-8-10-31(38)20-12-22(33)21-13-24(40-17(3)32)23(34)14-28(21,4)19(20)7-9-29(25,31)5/h12,15-16,18-19,21,23-26,34-35,37-38H,7-11,13-14H2,1-6H3/t15-,16+,18-,19-,21-,23-,24+,25-,26+,28+,29+,30+,31+/m0/s1 |
| |
CI-MS (NH3) m/z | | MS (thermospray) m/z | 580 [M+NH4]+, 563 [M+H]+, 562 [M]+, 545 [M+H-H2O]+, 520 [M+NH4-CH3COOH]+, 502 [M-CH3COOH]+ | HR-MS | |
|
|
C5D5N | 01 | 38.74 * | 02 | 66.10 | 03 | 71.29 | 04 | 29.65 | 05 | 51.95 | 06 | 202.13 | 07 | 121.65 | 08 | 166.21 | 09 | 34.41 | 10 | 38.62 * | 11 | 21.09 & | 12 | 31.91 | 13 | 48.17 | 14 | 84.11 | 15 | 32.01 | 16 | 21.36 & | 17 | 49.66 | 18 | 17.91 | 19 | 24.28 | 20 | 76.77 | 21 | 21.01 | 22 | 73.99 | 23 | 34.52 | 24 | 48.70 | 25 | 42.46 | 26 | 179.18 | 27 | 15.94 | 28 | 79.83 | 29 | 19.35 | CH3CO- | 21.09, 170.57 |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | 4.29 (br, w1/2 = 22.3) | 03-He | 5.50 (br, w1/2 = 9.3) | 04-Ha | | 04-He | | 05-H | 2.67 (dd, 13.2, 4.2) | 07-H | 6.28 (d, 2.4) | 09-Ha | 3.59 (brt, w1/2 = 23.0) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | 2.87 (bt, 9.0) | 18-Me | 1.25 (s ) | 19-Me | 1.09 (s ) | 21-Me | 1.58 (s ) | 22-H | 3.95 (br, w1/2 = 17) | 23-Ha | | 23-Hb | | 24-H | | 25-H | 2.38 (dq, 11.1, 6.9) | 26-Me | ? | 27-Me | 1.37 (d, 6.9) | 28-H | 4.01 (dq, 9.3, 6.0) | 29-Me | 1.31 (d, 6) | Ac-O | 1.97 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | RP Lichrospher 100 RP-18, 5 ?m, solvent iPrOH-H2O 1:10, 55°C, 1 ml.min-1, Retention time 20 min (coelutes with 20E3Ac); RP Spherisorb 10ODS2, 300 x 7.8 mm, solvent iPrOH-H2O 1.1:10, 55°C, 3 ml.min-1 Retention time 51.2 min (vs 39.1 min for 29NCy3Ac) |
| |
Drosophila melanogaster BII cell assay: EC50 = 4.3 x 10-7M |
| |
|
Permanent link to this datasheet: CYASTERONE 3-ACETATE
|
|