|
|
Year of first isolation: |
1985 |
Formula: | C45H76O8 |
Molecular weight: | 744 |
Occurence in plants: |
|
Occurence in animals: |
Ornithodoros moubata [Argasidae] » ![Wikipedia: Ornithodoros moubata [Argasidae]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OC(CCC(C)(C)O)(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)OC(=O)CCCCCCC/C=CCCCCCCCC)O)O)C)C » 
| IUPAC Name | [(3R)-2,3,6-trihydroxy-6-methyl-2-[(2S,3R,5R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-yl] (Z)-octadec-9-enoate | CAS-RN | | PubChem CID | 129819410 | InChiKey [ ChemIDPlus: search ] | AWCLAYVXCPADBI-AOHOABCESA-N | InChI | InChI=1S/C45H76O9/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-39(49)54-45(53,28-27-40(2,3)50)43(6,51)38-24-26-44(52)33-29-35(46)34-30-36(47)37(48)31-41(34,4)32(33)23-25-42(38,44)5/h14-15,29,32,34,36-38,47-48,50-53H,7-13,16-28,30-31H2,1-6H3/b15-14-/t32?,34-,36+,37-,38+,41+,42+,43?,44+,45+/m0/s1 |
| |
CI-MS (NH3) m/z | 762 (M+H+NH3)+, 745 (M+H)+, 727, 709, 691, 463 (M-fatty acid)+, 445, 427, 409, 363, 345 | EI-MS m/z (relative intensity %) | | SI-MS m/z | 745 (M+H)+, 727, 709, 691, 463 (M-fatty acid)+, 445, 427, 353, 301 |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CDCl3 | 01-Ha | | 01-He | | 02-Ha | 3.88 (m ) | 03-He | 4.04 (m ) | 04-Ha | | 04-He | | 05-H | 2.43 (m ) | 07-H | 5.85 (d, 1.7) | 09-Ha | 3.00 (m ) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.86 (s ) | 19-Me | 0.99 (s ) | 21-Me | 1.21 (s ) | 22-H | 4.89 (d, 9.4) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.24 (s ) | 27-Me | 1.24 (s ) | CH= | 5.34 (2H, m, 9´-, 19´-H) | O-COCH2 | 2.37 (t, 7.0) | termin CH3 | 0.88 (t, 6.7) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | 1715 (CO), 1654 (cyclohexenone) | UV (EtOH) λ max (log ε) | 242 (?) ; |
| |
HPTLC | | TLC | | GLC | (of fatty acid methyl esters) | HPLC | RP-HPLC, Retention time 27 min [YMC pack ODS column, 15 cm long, 6 mm i.d., eluted with MeOH-H2O 9:1 v/v at 1.25 ml.min-1] |
| |
| |
|
Permanent link to this datasheet: 20-HYDROXYECDYSONE 22-OLEATE
|
|