|
|
|
|
Year of first isolation: |
2008 |
| Formula: | C27H44O7 |
| Molecular weight: | 480 |
| Occurence in plants: |
Leuzea carthamoides [Asteraceae] » ![Wikipedia: Leuzea carthamoides [Asteraceae]](/images/wikipedia.png)
|
| Occurence in animals: |
|
|
|
| |
| Canonical SMILES | CC(C)CCC(C(C)(C1CC(C2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1([C@@H](C[C@@H]2[C@](C)([C@@H](CCC(C)C)O)O)O)O)C)C » 
| | IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,15R,17S)-17-[(2R,3R)-2,3-dihydroxy-6-methylheptan-2-yl]-2,3,14,15-tetrahydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | | CAS-RN | | | PubChem CID | 101851582 | InChiKey [ ChemIDPlus: search ] | DJGJBKOKVVFGFR-IMLUKNQASA-N | | InChI | InChI=1S/C27H44O7/c1-14(2)6-7-22(31)26(5,33)21-12-23(32)27(34)16-10-18(28)17-11-19(29)20(30)13-24(17,3)15(16)8-9-25(21,27)4/h10,14-15,17,19-23,29-34H,6-9,11-13H2,1-5H3/t15-,17-,19+,20-,21-,22+,23+,24+,25+,26+,27-/m0/s1 |
| |
| EI-MS m/z (relative intensity %) | | | ESI-MS m/z | 503.2990 [M+Na]+ (calculated for C27H44O7Na : 503.2985) | | CI-MS (NH3) m/z | | | ESI-MS/MS m/z | 481 [M+H]+, 463 [M+H-H20]+, 455 [M+H-2H20]+, 427 [M+H-3H2O]+, 409 [M+H-4H2O]+, 401 [M+H-2H2O-C3H8]+, 329, 317, 311, 299, 279 HR |
|
|
| CD3OD | | 01 | 37.40 | | 02 | 68.66 | | 03 | 68.59 | | 04 | 32.70 | | 05 | 51.47 | | 06 | 206.68 | | 07 | 124.56 | | 08 | 165.77 | | 09 | 35.17 | | 10 | 39.58 | | 11 | 21.28 | | 12 | 34.01 | | 13 | 47.48 | | 14 | 85.19 | | 15 | 76.84 | | 16 | 35.59 | | 17 | 49.96 | | 18 | 18.11 | | 19 | 24.22 | | 20 | 77.58 | | 21 | 21.00 | | 22 | 77.92 | | 23 | 37.62 | | 24 | 30.38 | | 25 | 29.22 | | 26 | 22.73 | | 27 | 23.42 |
|
| CD3OD | | 01-Ha | 1.43 | | 01-He | 1.79 | | 02-Ha | 3.81 (ddd, 12.2, 4.2, 3.0) | | 03-He | 3.96 (q, 3, 3, 3) | | 04-Ha | 1.79 | | 04-He | 1.72 | | 05-H | 2.37 (dd, 13.2, 4.4) | | 07-H | 6.47 (d, 2.6) | | 09-Ha | 3.13 (ddd, 11.5, 7.0, 2.6) | | 11-Ha | 1.75-1.80 | | 11-He | 1.75-1.80 | | 12-Ha | 2.11 (td, 13, 13, 5) | | 12-He | 1.85 | | 15-H | 4.13 (m) | | 16-Ha | 1.92 | | 16-Hb | 2.24 | | 17-H | 2.25 | | 18-Me | 1.137 (s) | | 19-Me | 1.002 (s) | | 21-Me | 1.188 (s) | | 22-H | 3.30 (dd, 11, 1.5) | | 23-Ha | 1.48 | | 23-Hb | 1.22 | | 24-Ha | 1.51 | | 24-Hb | 1.22 | | 25-H | 1.57 | | 26-Me | 0.908 (d, 6.5) | | 27-Me | 0.920 (d, 6.5) |
|
| |
| M.P. | °C ; | | [α]D20 | + 41.2 ° (c 0.17; EtOH) | | IR (KBr) ν max (cm-1) | 3585, 3563, 3370 (OH), 1646 (C=O), 1055, 1008, 988 (C-O) | | UV (MeOH) λ max (log ε) | |
| |
| HPLC | RP-HPLC Separon SGX C-18 (250 x 4 mm), solvent methanol-water (linear grad of 10-70%), flow-rate 0,6 ml/min (Ret 55.0 min); NP-HPLC Silasorb 600 (250 x 4 mm) solvent dichloromethane-isopropanol-water (84:15:1), flow-rate 0.8 ml/min (Ret 28.0 min); and two other systems. | | GLC | | | HPTLC | | | TLC | |
| |
| |
| |
Permanent link to this datasheet: 15-HYDROXYPONASTERONE A
|
|