|
|
Year of first isolation: |
1991 |
Formula: | C35H56O13 |
Molecular weight: | 684 |
Occurence in plants: |
Melandrium turkestanicum [Caryophyllaceae] » ![Wikipedia: Melandrium turkestanicum [Caryophyllaceae]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H](O[C@@H]1C(C([C@H](C(O1)CO)O)O)O)CCC(C)(C)OC(=O)C)O)O)C)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | CC(=O)OC(C)(C)CC[C@H]([C@@](C)([C@H]1CC[C@@]2([C@@]1(CC[C@H]3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)C)O)O)O[C@@H]5[C@@H]([C@H]([C@H]([C@H](O5)CO)O)O)O » ![JSMol: View in 3D](/images/3D.png)
| IUPAC Name | [(5R,6R)-6-hydroxy-2-methyl-6-[(2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl] acetate | CAS-RN | | PubChem CID | 21770555 | InChiKey [ ChemIDPlus: search ] | URINUHVDRGPXSD-NSYLOLJSSA-N | InChI | InChI=1S/C35H56O13/c1-17(37)48-31(2,3)10-9-26(47-30-29(43)28(42)27(41)24(16-36)46-30)34(6,44)25-8-12-35(45)19-13-21(38)20-14-22(39)23(40)15-32(20,4)18(19)7-11-33(25,35)5/h13,18,20,22-30,36,39-45H,7-12,14-16H2,1-6H3/t18-,20-,22+,23-,24+,25-,26+,27-,28-,29+,30+,32+,33+,34+,35+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 588 (M-CH3COOH-2H2O)+ (0.7), 573 (0.4), 570 (0.8), 46 (1.5), 444 (18), 426 (80), 411 (26), 408 (60), 393 (27), 363 (18), 345 (100), 328 (98), 327 (99), 301 (40), 400 (40), 145 (30), 144 (32), 125 (32), 99 (32), 81 (32), 69 (32) | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | 3.99-4.10 | 03-He | 3.99-4.10 | 04-Ha | | 04-He | | 05-H | | 07-H | 6.04 | 09-Ha | 3.47 | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.07 | 19-Me | 0.91 | 21-Me | 1.51 | 22-H | 3.58 | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.40* | 27-Me | 1.47* | O-Ac | 1.84 (3H) | sugar H-1' | 5.46 (d ) |
|
| |
M.P. | 204-206 °C | [α]D20 | + 92.3 ? 2 ° (c 0.17; MeOH) | IR (KBr) ν max (cm-1) | 3400-3450 (OH), 1670 (cyclohexenone), 1720, 1270 | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: MELANDRIOSIDE A
|
|