|
|
Year of first isolation: |
2009 |
Formula: | C35H54O12 |
Molecular weight: | 666 |
Occurence in plants: |
Lygodium japonicum [fern] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CCC1CC(OC(=O)C1C)C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)OC6C(C(C(C(O6)CO)O)O)O)O)C)C)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O[C@H]1C(C([C@@H](C(O1)CO)O)O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H]1OC(=O)[C@H]([C@@H](C1)CC)C)O)O)C)C » 
| IUPAC Name | (4R,6R)-6-[(1R)-1-[(2R,3R,5R,9R,10R,13R,14S,17S)-2,14-dihydroxy-10,13-dimethyl-6-oxo-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-1-hydroxyethyl]-4-ethyl-3-methyloxan-2-one | CAS-RN | | PubChem CID | 102422558 | InChiKey [ ChemIDPlus: search ] | SVCLWTYQLVQMLJ-JMUVMLHESA-N | InChI | InChI=1S/C35H54O12/c1-6-17-11-26(47-30(42)16(17)2)34(5,43)25-8-10-35(44)19-12-21(37)20-13-23(45-31-29(41)28(40)27(39)24(15-36)46-31)22(38)14-32(20,3)18(19)7-9-33(25,35)4/h12,16-18,20,22-29,31,36,38-41,43-44H,6-11,13-15H2,1-5H3/t16?,17-,18+,20+,22-,23-,24-,25+,26-,27-,28+,29-,31-,32-,33-,34-,35-/m1/s1 |
| |
ESI-MS m/z (negative mode) | 665.6 [M-H]- | HR-ESI-MS m/z | 701.3309 [M+Cl]+, calculated for C35H54O12Cl 701.3309 |
|
|
C5D5N | 01 | 38.0 | 02 | 66.8 | 03 | 77.1 | 04 | 29.9 | 05 | 50.7 | 06 | 202.3 | 07 | 121.1 | 08 | 165.4 | 09 | 33.5 | 10 | 38.4 | 11 | 20.3 | 12 | 31.2 | 13 | 47.2 | 14 | 83.4 | 15 | 31.1 | 16 | 20.7 | 17 | 49.2 | 18 | 17.3 | 19 | 23.4 | 20 | 75.1 | 21 | 20.7 | 22 | 85.3 | 23 | 29.0 | 24 | 39.5 | 25 | 40.7 | 26 | 183.9 | 27 | 15.2 | 28 | 25.9 | 29 | 9.6 | glu-1' | 103.5 | glu-2' | 74.0 | glu-3' | 78.0 | glu-4' | 70.9 | glu-5' | 77.8 | glu-6' | 61.9 |
|
C5D5N | 01-H | 1.72 (t, 12.6), 2.05 (m) | 02-Ha | 4.06 (brd, 11.4) | 03-He | 4.29 (brs) | 04-H | 1.66 (m), 2.16 (m) | 05-H | 2.90 (m) | 07-H | 6.18 (brs) | 09-H | 3.50 (brt) | 11-H | 1.64 (m), 1.77 (m) | 12-H | 1.86 (m), 2.57 (m) | 15-H | 1.86 (m), 2.12 (m) | 16-H | 2.05 (m), 2.57 (m) | 17-H | 2.93 (m) | 18-Me | 1.09 (s) | 19-Me | 0.86 (s) | 21-Me | 1.44 (s) | 22-H | 4.44 (dd, 11.5, 2.5) | 23-H | 1.41 (m), 2.05 (m) | 24-H | 1.41 (m) | 25-H | 2.17 (m) | 27-Me | 1.28 (d, 7.2) | 28-H | 1.01 (m), 1.37 (m) | 29-Me | 0.67 (t, 7.2) | H-1' | 4.89 (d, 7.8) | H-2' | 4.01 (t-like) | H-3' | 4.18 (overlap) | H-4' | 4.06 (overlap) | H-5' | 3.90 (t-like) | H-6" | 4.49 (brd, 11.5) | H-6' | 4.31 (m) |
|
| |
M.P. | 245-246 °C ; | [α]D20 | ° (c ; MeOH) | IR (KBr) ν max (cm-1) | 3416 (OH), 1730 (?-lactone), 1646 (cyclohexenone) | UV (MeOH) λ max (log ε) | 243 (nm) ; |
| |
| |
| |
|
Permanent link to this datasheet: LYGODIUMSTEROSIDE A
|
|