|
|
Year of first isolation: |
1991 |
Formula: | C30H48O6 |
Molecular weight: | 504 |
Occurence in plants: |
Silene brahuica [Caryophyllaceae] » Silene viridiflora [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1(OC(C(O1)(C)C2CCC3(C2(CCC4C3=CC(=O)C5C4(CCC(C5)O)C)C)O)CCC(C)(C)O)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H](C1)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@]1(C)[C@@H](CCC(C)(C)O)OC(O1)(C)C)O)C)C »
| IUPAC Name | (3S,5R,9R,10R,13R,14S,17S)-3,14-dihydroxy-17-[(4R,5R)-5-(3-hydroxy-3-methylbutyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 14828330 | InChiKey [ ChemIDPlus: search ] | GIDOJSDRNURPMM-PZCXLVCPSA-N | InChI | InChI=1S/C30H48O6/c1-25(2,33)12-11-24-29(7,36-26(3,4)35-24)23-10-15-30(34)20-17-22(32)21-16-18(31)8-13-27(21,5)19(20)9-14-28(23,30)6/h17-19,21,23-24,31,33-34H,8-16H2,1-7H3/t18-,19-,21-,23-,24+,27+,28+,29+,30+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 504 (0.4) (M)+, 489 (0.6), 486 (0.6), 471 (1.2), 453 (1.2), 429 (2), 411 (19), 405 (2), 393 (5), 347 (100), 329 (25), 287 (7.2), 234 (9), 233 (6), 201 (8), 143 (21), 125 (21), 102 (40), 99 (40), 81 (10). | HR-MS | |
|
|
CD3OD | 01 | 29.9 | 02 | 29.4 | 03 | 65.5 | 04 | 33.3 | 05 | 52.4 | 06 | 206.5 | 07 | 122.0 | 08 | 168.3 | 09 | 34.6 | 10 | 37.6 | 11 | 21.9 | 12 | 32.6 | 13 | 49.2 | 14 | 85.6 | 15 | 31.7 | 16 | 22.6 | 17 | 50.6 | 18 | 17.8 | 19 | 24.5 | 20 | 85.9 | 21 | 22.7 | 22 | 83.4 | 23 | 24.8 | 24 | 42.3 | 25 | 71.2 | 26 | 29.1 | 27 | 29.6 | Me2C | 108.1, 27.3, 29.5 |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | | 02-Hb | | 03-He | 4.12 | 04-Ha | | 04-He | | 05-H | | 07-H | 6.25 | 09-Ha | 3.47 | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.05 | 19-Me | 1.05 | 21-Me | 1.56 | 22-H | 3.95 | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.37 | 27-Me | 1.37 | Me2C | 1.37, 1.48 |
|
| |
M.P. | | [α]D20 | + 78.2 ° (c 0.32 ; MeOH) | IR (KBr) ν max (cm-1) | 3400-3500 (OH), 1670 (cyclohexenone); | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: 2-DEOXY-20-HYDROXYECDYSONE 20,22-MONOACETONIDE
|
|