|
|
Year of first isolation: |
2001 |
Formula: | C38H62O16 |
Molecular weight: | 774 |
Occurence in plants: |
Limnanthes alba [Limnanthaceae] » ![Wikipedia: Limnanthes alba [Limnanthaceae]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O[C@H]1C(C([C@@H](CO1)O)O[C@@H]1C(C([C@@H](C(O1)CO)O)O)O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H](O)CCC(C)(C)O)O)O)C)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-3-(((2S,5R)-3,5-dihydroxy-4-(((2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-2,14-dihydroxy-10,13-dimethyl-17-((2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | CLHMVLWTBMDTQO-LOWAPULFSA-N | InChI | InChI=1S/C38H62O16/c1-34(2,48)9-8-26(43)37(5,49)25-7-11-38(50)18-12-20(40)19-13-23(21(41)14-35(19,3)17(18)6-10-36(25,38)4)52-32-30(47)31(22(42)16-51-32)54-33-29(46)28(45)27(44)24(15-39)53-33/h12,17,19,21-33,39,41-50H,6-11,13-16H2,1-5H3/t17-,19-,21-,22+,23+,24?,25-,26+,27+,28?,29?,30?,31?,32-,33+,35+,36+,37+,38+/m0/s1 |
| |
EI-MS m/z (relative intensity %) | | LSI-MS (positive ion mode) m/z | 775 [M+H]+ | CI-MS (NH3) m/z | |
|
|
CD3OD | 01 | 37.2 | 01" | 103.6 | 01' | 101.8 | 02 | 66.6 | 02" | 74.1 | 02' | 72.4 | 03 | 75.1 | 03" | 76.5 | 03' | 85.5 | 04 | 29.0 | 04" | 72.2 | 04' | 68.5 | 05 | 50.3 | 05" | 77.0 | 05' | 65.2 | 06 | 204.9 | 07 | 120.7 | 08 | 166.9 | 09 | 33.7 | 10 | 37.8 | 11 | 20.2 | 12 | 31.1 | 13 | ** | 14 | 83.8 | 15 | 30.4 | 16 | 20.1 | 17 | 49.1 | 18 | 16.6 | 19 | 22.8 | 20 | 76.6 | 21 | 19.6 | 22 | 76.8 | 23 | 25.9 | 24 | 41.0 | 25 | 69.9 | 26 | 28.3 | 27 | 27.6 | 6'' | 61.3 |
|
CD3OD | 01-Ha | 1.42 | 01-He | 1.84 | 02-Ha | 3.85 (m, w1/2 = 22) | 03-He | 4.06 (m, w1/2 = 8) | 04-Ha | 1.69 | 04-He | 1.88 | 05-H | 2.43 (dd, 13, 3.8) | 07-H | 5.82 (d, 2.2) | 09-H | 3.15 (m, w1/2 = 21) | 11-Ha | 1.68 | 11-He | 1.82 | 12-Ha | 2.14 (ddd, 13, 13, 5) | 12-He | 1.88 | 15-Ha | 1.96 | 15-Hb | 1.59 | 16-Ha | 2.00 | 16-Hb | 1.73 | 17-H | 2.39 (m) | 18-Me | 0.89 (s) | 19-Me | 0.97 (s) | 1"ax | 4.61 (d, 7.6) | 1'ax | 4.38 (d, 7.3) | 21-Me | 1.20 (s) | 22-H | 3.33 | 23-Ha | 1.29 | 23-Hb | 1.67 | 24-Ha | 1.81 | 24-Hb | 1.42 | 26-Me | 1.19 (s) | 27-Me | 1.20 (s) | 2"ax | 3.28 (dd, 7.6, 9.0) | 2'ax | 3.49 (dd, 7.3, 8.9) | 3"ax | 3.40 (t, 9.0) | 3'ax | 3.54 (t, 8.9) | 4"ax | 3.29 (t, 9.0) | 4'ax | 3.63 (ddd, 5.1, 8.9, 11) | 5"ax | 3.32 (ddd 2.0, 5.8, 9.0) | 5'ax | 3.94 (dd, 5.1, 11.5) | 5'eq | 3.26 (dd, 11, 11.5) | 6"ax | 3.64 (dd, 11.8, 5.8) | 6"eq | (dd, 11.8, 2.0) |
|
| |
M.P. | °C ; white amorphous | [α]D20 | ° (c ; MeOH) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | 243 (4.12) ; |
| |
HPLC | RP-HPLC C6 column, solvent MeOH-H2O (40:60); NP-HPLC Diol column, solvent CH2Cl2-MeOH (97:3) | GLC | | HPTLC | | TLC | |
| |
| |
|
Permanent link to this datasheet: LIMNANTHEOSIDE C
|
|