|
|
Year of first isolation: |
1972 |
Formula: | C27H44O6 |
Molecular weight: | 464 |
Occurence in plants: |
|
Occurence in animals: |
Manduca sexta [Lepidoptera] » Leucophaea maderae [Blaberidae] »
|
|
| |
Canonical SMILES | CC(CCCC(C)(CO)O)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)CCCC(CO)(C)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)CCC[C@@](CO)(C)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)CCC[C@](CO)(C)O)O)C)C »
| IUPAC Name | (2S,3R,5R,10R,13R,14S,17R)-17-(6,7-dihydroxy-6-methylheptan-2-yl)-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 129725071 | InChiKey [ ChemIDPlus: search ] | DTHYJIUPIBIHOY-UDBMUEIZSA-N | InChI | InChI=1S/C27H44O6/c1-16(6-5-9-24(2,32)15-28)17-8-11-27(33)19-12-21(29)20-13-22(30)23(31)14-25(20,3)18(19)7-10-26(17,27)4/h12,16-18,20,22-23,28,30-33H,5-11,13-15H2,1-4H3/t16?,17-,18?,20+,22-,23+,24?,25-,26-,27-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 590 (M)+ for 2,3,26-triacetate | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CDCl3 (2,3,26-OAc) | 01-Ha | | 01-He | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.68 | 19-Me | 1.03 | 21-Me | 0.87 and 0.98 | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | | 27-Me | 1.23 | OAC | 2.00, 2.11, 2.11 |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: 22-DEOXY-26-HYDROXYECDYSONE
|
|