|
|
Year of first isolation: |
2000 |
Formula: | C27H45O10P |
Molecular weight: | 560 |
Occurence in plants: |
|
Occurence in animals: |
Bombyx mori [Bombycidae] »
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@@H]([C@H]1OP(=O)([O-])[O-])O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)(CCCC(CO)(C)O)O)O)C)C » C1[C@]2([C@@H](C[C@@H]([C@H]1OP(=O)([O-])[O-])O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)(CCCC(CO)(C)O)O)O)C)C » C1[C@]2([C@@H](C[C@@H]([C@H]1OP(=O)([O-])[O-])O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)(CCCC(CO)(C)O)O)O)C)C »
| IUPAC Name | (2S,3S,5R,9R,10R,13R,14S,17S)-3,14-dihydroxy-10,13-dimethyl-6-oxo-17-((2S)-2,6,7-trihydroxy-6-methylheptan-2-yl)-2,3,4,5,6,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-2-yl phosphate | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | HDFBSOFKEFOGKM-IPIKEVATSA-L | InChI | InChI=1S/C27H45O10P/c1-23(31,15-28)8-5-9-26(4,32)22-7-11-27(33)17-12-19(29)18-13-20(30)21(37-38(34,35)36)14-24(18,2)16(17)6-10-25(22,27)3/h12,16,18,20-22,28,30-33H,5-11,13-15H2,1-4H3,(H2,34,35,36)/p-2/t16-,18-,20-,21-,22-,23?,24+,25+,26-,27+/m0/s1 |
| |
EI-MS m/z (relative intensity %) | | FAB-MS m/z | 97 [H2PO4] -, 79 [PO3] - |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CD3OD | 01-Ha | | 01-He | | 02-Ha | 4.24 (m, w1/2 = 34) | 03-Ha | 3.55 (m, w1/2 = 22) | 04-Ha | | 04-He | | 05-H | 2.09 (dd, 14.3, 3.8) | 07-H | 5.81 (d, 2.4) | 09-H | overlap with solvent | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.84 (s) | 19-Me | 0.95 (s) | 21-Me | 1.27 (s) | 22-Ha | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-H2/3 | 3.35 (s) | 27-Me | 1.13 (s) |
|
| |
M.P. | - °C ; | [α]D20 | ? ° (c ; MeOH) | IR (KBr) ν max (cm-1) | | UV (MeOH) λ max (log ε) | 243 nm (-) ; |
| |
HPLC | RP-HPLC column Wakosil 5C18, 250x10 mm, flow-rate 2 ml/min, solvent linear gradient of MeOH in 20 mM phosphate buffer, pH 5.56, changing from 1:9 to 7:3 in 70 min, Ret 49.8 min.RP-HPLC column Wakosil 5C18, 250x4.6 mm, flow-rate 1 ml/min, solvent 25 % aqueous MeOH, Ret 9.7 min. | GLC | | TLC | |
| |
| |
|
Permanent link to this datasheet: 3-EPI-22-DEOXY-20,26-DIHYDROXYECDYSONE 2-PHOSPHATE
|
|