|
|
Year of first isolation: |
1998 |
Formula: | C39H64O17 |
Molecular weight: | 804 |
Occurence in plants: |
Silene tatarica [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)OC5C(C(C(C(O5)COC6C(C(C(C(O6)CO)O)O)O)O)O)O)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O[C@H]1C(C([C@H](C(O1)CO[C@@H]1C(C([C@H](C(O1)CO)O)O)O)O)O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O)C)C »
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-2,14-dihydroxy-10,13-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-3-[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[[(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxymethyl]oxan-2-yl]oxy-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 102316919 | InChiKey [ ChemIDPlus: search ] | QMUZULHLTKODCA-FNKAHMMCSA-N | InChI | InChI=1S/C39H64O17/c1-35(2,50)9-8-26(43)38(5,51)25-7-11-39(52)18-12-20(41)19-13-22(21(42)14-36(19,3)17(18)6-10-37(25,39)4)54-34-32(49)30(47)28(45)24(56-34)16-53-33-31(48)29(46)27(44)23(15-40)55-33/h12,17,19,21-34,40,42-52H,6-11,13-16H2,1-5H3/t17-,19-,21-,22+,23+,24+,25-,26+,27-,28-,29-,30-,31+,32+,33-,34-,36+,37+,38+,39+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 588 (3), 573 (3), 570 (6), 555 (2.1), 552 (2.4), 534 (2.1), 516 (1.5), 501, 462, 455, 444 (30), 426 (36), 411 (15), 408 (15), 393 (10), 375, 357, 345 (12), 327, 300 (100), 99 (30, 81 (27). | HR-MS | |
|
|
C5D5N | 01 | 38.53 | 02 | 68.08 | 03 | 79.15 | 04 | 31.43 | 05 | 52.43 | 06 | 202.97 | 07 | 121.51 | 08 | 166.51 | 09 | 34.25 | 10 | 39.39 | 11 | 21.04 | 12 | 31.68 | 13 | 48.06 | 14 | 84.12 | 15 | 31.68 | 16 | 21.46 | 17 | 50.10 | 18 | 17.84 | 19 | 24.27 | 20 | 76.87 | 21 | 21.67 | 22 | 77.57 | 23 | 22.45 | 24 | 42.60 | 25 | 69.57 | 26 | 29.99 | 27 | 30.06 | H-01' | 103.71 | H-02' | 71.02 | H-03' | 71.78 | H-04' | 71.02 | H-05' | 73.46 | H-06' | 62.62 | H-1" | 101.75 | H-2" | 70.95 | H-3" | 71.66 | H-4" | 70.56 | H-5" | 72.59 | H-6" | 62.62 |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | 4.04 | 03-He | 4.08 | 04-Ha | | 04-He | | 05-H | | 07-H | 6.19 | 09-H | 3.45 (m) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.19 (s) | 19-Me | 0.97 (s) | 21-Me | 1.57 (s) | 22-H | 3.84 (dd) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.35 (s) | 27-Me | 1.35 (s) | H-01' | 5.56 (d, 4) | H-1'' | 5.16 (d, 4) |
|
| |
M.P. | 228-230 °C ; | [α]D20 | + 100.4 ? ° (c 2.59 ; MeOH) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: ECDYSTEROSIDE
|
|