|
|
|
|
Year of first isolation: |
1984 |
| Formula: | C27H45O9P |
| Molecular weight: | 544 |
| Occurence in plants: |
|
|
| Occurence in animals: |
Schistocerca gregaria [Orthoptera] »  ![Wikipedia: Schistocerca gregaria [Orthoptera]](/images/wikipedia.png)
|
|
| |
| Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)OP(=O)(O)O)C)C)O)C(CCC(C)(C)O)O | Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1OP(=O)([O-])[O-])O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)O)O)C)C » 
| | IUPAC Name | [(2S,3R,5R,9R,10R,13R,14S,17R)-17-[(2S)-3,6-dihydroxy-6-methylheptan-2-yl]-3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] dihydrogen phosphate | | CAS-RN | | | PubChem CID | 53893248 | InChiKey
[ ChemIDPlus: search ] | HRYWFGLNHJWAAL-PMXHCISBSA-N | | InChI | InChI=1S/C27H45O9P/c1-15(20(28)8-9-24(2,3)31)16-7-11-27(32)18-12-21(29)19-13-22(30)23(36-37(33,34)35)14-25(19,4)17(18)6-10-26(16,27)5/h12,15-17,19-20,22-23,28,30-32H,6-11,13-14H2,1-5H3,(H2,33,34,35)/t15-,16+,17-,19-,20?,22+,23-,25+,26+,27+/m0/s1 |
| |
| CI-MS (NH3) m/z | | | EI-MS m/z (relative intensity %) | | | FAB-MS m/z | 565 (M-H+Na)-, 543 (M-H)-, 525 (M-H-18)-, 97, 79 | | HR-MS | |
|
|
| C5D5N | | 01 | | | 02 | | | 03 | | | 04 | | | 05 | | | 06 | | | 07 | | | 08 | | | 09 | | | 10 | | | 11 | | | 12 | | | 13 | | | 14 | | | 15 | | | 16 | | | 17 | | | 18 | | | 19 | | | 20 | | | 21 | | | 22 | | | 23 | | | 24 | | | 25 | | | 26 | | | 27 | |
|
| CD3OD | | 01-Ha | | | 01-He | | | 02-Ha | 4.37 (m, w1/2=24) | | 03-He | 4.18 (m, w1/2=8) | | 04-Ha | | | 04-He | | | 05-H | | | 07-H | 5.80 (d, 2) | | 09-Ha | | | 11-Ha | | | 11-He | | | 12-Ha | | | 12-He | | | 14-H | | | 15-Ha | | | 15-Hb | | | 16-Ha | | | 16-Hb | | | 17-H | | | 18-Me | 0.72 (s ) | | 19-Me | 0.97 (s ) | | 21-Me | 0.945 (d, 7) | | 22-H | | | 23-Ha | | | 23-Hb | | | 24-Ha | | | 24-Hb | | | 25-H | | | 26-Me | 1.19 (s ) | | 27-Me | 1.20 (s ) |
|
| |
| M.P. | | | [α]D20 | | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | |
| |
| HPLC | HPLC (ion-exchange) : Retention volume 31 ml [column Whatman Partisil-SAX, 25 cm long, 4.6 mm i.d., eluted with 0.1 M ammonium acetate, flow-rate 2 ml.min-1]. RP-HPLC (ion suppression) : Retention volume 44 ml [column Whatman Partisil-ODS3, 25 cm long, 4.6 mm i.d., eluted with MeOH/20 mM Na citrate pH 6.5, linear gradient 1:9 to 1:3 v/v over 30 min, flow-rate 2 ml.min-1]. | | TLC | | | GLC | |
| |
| |
| |
Permanent link to this datasheet: ECDYSONE 2-PHOSPHATE
|
|
