|
|
Year of first isolation: |
1970 |
Formula: | C27H42O6 |
Molecular weight: | 462 |
Occurence in plants: |
Stachyurus praecox [Stachyuraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC12CCC(C1=CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C(C)(C(CCC(C)(C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC=C2[C@@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)C)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,14S,17S)-2,3-dihydroxy-10,14-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-1,2,3,4,5,9,11,15,16,17-decahydrocyclopenta[a]phenanthren-6-one | CAS-RN | 30655-78-8 | PubChem CID | 24984906 | InChiKey [ ChemIDPlus: search ] | DSUMGVHMUUADBM-VXUDCIMKSA-N | InChI | InChI=1S/C27H42O6/c1-24(2,32)10-9-23(31)27(5,33)17-8-11-25(3)15(17)6-7-16-18(25)12-20(28)19-13-21(29)22(30)14-26(16,19)4/h6,12,16-17,19,21-23,29-33H,7-11,13-14H2,1-5H3/t16-,17-,19-,21+,22-,23+,25-,26+,27+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 462 (M)+; 426 (M - 2x18)+, 345 (M- C22-C27)+ (9), 327 (4), 143 (C20-C27)+ (96), 125 (34), 99 (C22-C27)+ (20), 81 (28), 43 (100). | HR-MS | 426.2699 (for C27H38O4, calc. 426.2769) |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | 4.09 (m, w1/2=22) | 03-He | 4.31 (m, w1/2=8) | 04-Ha | | 04-He | | 05-H | | 07-H | 6.14 (d, 2.5) | 09-Ha | | 11-Ha | | 11-He | | 12-H | 5.98 (m ) | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | -- | 19-Me | 0.92 (s ) | 21-Me | 1.51 (s ) | 22-H | 3.85 (m ) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 1.41 (s ) | 27-Me | 1.41 (s ) | Other14-Me | 1.20 (s ) |
CDCl3 (2,3,22-OAc) | 01-Ha | | 01-He | | 02-Ha | 4.90-5.10 (m ) | 03-He | 5.35 (m, w1/2=7.5) | 04-Ha | | 04-He | | 05-H | 2.37 (dd, 13, 5) | 07-H | 5.93 (d, 2.5) | 09-Ha | | 11-Ha | | 11-He | | 12-H | 6.04 (m ) | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | -- | 19-Me | 0.98 (s ) | 21-Me | 1.30 (s ) | 22-H | 4.90-5.10 (m ) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 1.20 (s ) | 27-Me | 1.20 (s ) | Other14-Me | 1.15 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | 3400 (OH), 1640 (cyclohexenone), 1590 | UV (EtOH) λ max (log ε) | 248 (4.029) |
| |
| |
| |
|
Permanent link to this datasheet: STACHYSTERONE A
|
|