|
|
Year of first isolation: |
1971 |
Formula: | C29H44O8 |
Molecular weight: | 520 |
Occurence in plants: |
Cyathula capitata [Amaranthaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1C(C(OC1=O)C)CC(C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)O)O)C)C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C[C@@H]1[C@@H]([C@H](OC1=O)C)C[C@H]([C@](C)([C@H]2CC[C@@]3([C@@]2(CC[C@H]4C3=CC(=O)[C@H]5[C@@]4(C[C@@H]([C@@H](C5)O)O)C)C)O)O)O » 
| IUPAC Name | (3R,4S,5R)-4-[(2R,3S)-2,3-dihydroxy-3-[(2S,3R,5R,9R,10R,13R,14S,17S)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]butyl]-3,5-dimethyloxolan-2-one | CAS-RN | 54082-42-7 | PubChem CID | 56841054 | InChiKey [ ChemIDPlus: search ] | NEFYSBQJYCICOG-KBTANIATSA-N | InChI | InChI=1S/C29H44O8/c1-14-16(15(2)37-25(14)34)10-24(33)28(5,35)23-7-9-29(36)18-11-20(30)19-12-21(31)22(32)13-26(19,3)17(18)6-8-27(23,29)4/h11,14-17,19,21-24,31-33,35-36H,6-10,12-13H2,1-5H3/t14-,15-,16+,17+,19+,21-,22+,23+,24-,26-,27-,28+,29-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z | 502 (M-18)+, ?, 363, 345, 327, 201, 183, 157, 113 | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | | 28 | | 29 | |
|
CDCl3 | 01-Ha | | 02-Ha | ~ 5.05 | 03-He | ~ 5.33 (ddd ) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.86 (d ) | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.85 (s ) | 19-Me | 1.02 (s ) | 21-Me | 1.28 (s ) | 22-H | ~ 4.99 | 23-Ha | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | -- | 27-Me | 1.22 (d ) | 28-H | 4.64 (dq ) | 29-Me | 1.42 (d ) |
C5D5N | 01-Ha | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | 6.16 (d ) | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.16 (s ) | 19-Me | 1.04 (s ) | 21-Me | 1.52 (s ) | 22-H | | 23-Ha | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | -- | 27-Me | 1.24 (d ) | 28-H | | 29-Me | 1.19 (d ) |
|
| |
M.P. | amorphous | [α]D20 | +65.3 ° (c ; MeOH) | IR (KBr) ν max (cm-1) | 3425, 1755 (?-lactone), 1650 | UV (MeOH) λ max (log ε) | 242 (4.02) |
| |
| |
| |
|
Permanent link to this datasheet: ISOCYASTERONE [cf. 25-EPI-CYASTERONE]
|
|