|
|
Year of first isolation: |
1978 |
Formula: | C28H40O2 |
Molecular weight: | 408 |
Occurence in plants: |
Ganoderma lucidum [Fungi] » ![Wikipedia: Ganoderma lucidum [Fungi]](/images/wikipedia.png)
|
Occurence in animals: |
Raphidostila incisa [Porifera] » ![Wikipedia: Raphidostila incisa [Porifera]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | CC(C)C(C)C=CC(C)C1CCC2C1(CCC3C2=CC(=O)C4=CC(=O)CCC34C)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2(C(=CC(=O)C1)C(=O)C=C1[C@@H]2CC[C@]2(C1CC[C@@H]2[C@H](C)/C=C/[C@@H](C(C)C)C)C)C » ![JSMol: View in 3D](/images/3D.png) C1[C@]2(C(=CC(=O)C1)C(=O)C=C1[C@@H]2CC[C@]2([C@H]1CC[C@@H]2[C@H](C)/C=C/[C@@H](C(C)C)C)C)C » ![JSMol: View in 3D](/images/3D.png) C1[C@]2(C(=CC(=O)C1)C(=O)C=C1[C@@H]2CC[C@]2([C@@H]1CC[C@@H]2[C@H](C)/C=C/[C@@H](C(C)C)C)C)C » ![JSMol: View in 3D](/images/3D.png)
| IUPAC Name | (10R,13R,17R)-17-[(E,2R)-5,6-dimethylhept-3-en-2-yl]-10,13-dimethyl-2,9,11,12,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthrene-3,6-dione | CAS-RN | | PubChem CID | 23425004 | InChiKey [ ChemIDPlus: search ] | RMKUNHROPPZENV-RATFMIAWSA-N | InChI | InChI=1S/C28H40O2/c1-17(2)18(3)7-8-19(4)22-9-10-23-21-16-26(30)25-15-20(29)11-13-28(25,6)24(21)12-14-27(22,23)5/h7-8,15-19,22-24H,9-14H2,1-6H3/b8-7+/t18?,19-,22-,23?,24?,27-,28-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 408 [M]+ (80), 283 [M-side-chain]+ (100), 229 [M- C13H23]+ (33), 125 (13) | HR-MS | 408.3034, calcul. for C28H40O2 408.3028) |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | | 28 | |
|
CDCl3 | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.68 (s ) | 19-Me | 1.30 (s ) | 21-Me | 1.04 (d, 6.6) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 0.82 (d, 6.6) | 27-Me | 0.84 (d, 6.6) | 28-Me | 0.92 (d, 6.6) |
|
| |
M.P. | 156-159 °C | [α]D20 | | IR (KBr) ν max (cm-1) | 2950, 2870 (CH), 1665 (CO), 1640 (CO), 1620 (C=C), 1600 (C=C | UV (EtOH) λ max (log ε) | 275 (3.8) |
| |
HPTLC | | TLC | | GLC | | HPLC | RP-HPLC, Nucleosil C18 (300 x 10 mm), MeOH 3 ml.min-1, Ret 12.2 min. |
| |
| |
|
Permanent link to this datasheet: ERGOSTA-4,7,22-TRIENE-3,6-DIONE
|
|