|
|
Year of first isolation: |
1973 |
Formula: | C28H46O8 |
Molecular weight: | 510 |
Occurence in plants: |
Dacrydium intermedium [Podocarpaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(CC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4(C3(CC(C(C4)O)O)C)O)C)O)O)O)C(C)(C)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@](C[C@H]([C@H]1O)O)(C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](C[C@H](C(C)(C)O)C)O)O)O)C)O)C »
| IUPAC Name | (2S,3R,5S,9R,10R,13R,14S,17S)-2,3,5,14-tetrahydroxy-10,13-dimethyl-17-[(2R,3R,5R)-2,3,6-trihydroxy-5,6-dimethylheptan-2-yl]-1,2,3,4,9,11,12,15,16,17-decahydrocyclopenta[a]phenanthren-6-one | CAS-RN | 50299-45-1 | PubChem CID | 102239719 | InChiKey [ ChemIDPlus: search ] | LMQKRCYKYDRRFC-KDZLJHQNSA-N | InChI | InChI=1S/C28H46O8/c1-15(23(2,3)33)11-21(31)26(6,34)20-8-10-27(35)17-12-22(32)28(36)14-19(30)18(29)13-25(28,5)16(17)7-9-24(20,27)4/h12,15-16,18-21,29-31,33-36H,7-11,13-14H2,1-6H3/t15-,16+,18+,19-,20+,21-,24-,25-,26-,27-,28-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 492 [M-18]+ (1), 474 (2), 456 (3), 438 (3), 379 (50), 361 (47), 343 (23), 325 (25), 189 (20), 140 (22), 131 (13), 113 (100), 105 (26), 95 (66), 93 (20), 91 (25), 85 (28), 83 (23), 70 (96) | HR-MS | |
|
|
C5D5N | 01 | 34.7 | 02 | 67.9 | 03 | 69.7 | 04 | 35.8 | 05 | 79.7 | 06 | 200.7 | 07 | 119.8 | 08 | 166.8 | 09 | 38.2 | 10 | 44.7 | 11 | 21.2 | 12 | 31.6 | 13 | 48.1 | 14 | 84.0 | 15 | 32.0 | 16 | 22.0 | 17 | 49.8 | 18 | 17.8 | 19 | 17.0 | 20 | 76.9 | 21 | 21.5 | 22 | 74.7 | 23 | 34.5 | 24 | 41.7 | 25 | 72.1 | 26 | 26.4 * | 27 | 28.2 * | 28 | 15.3 |
|
C5D5N | 01-Ha | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.22 | 19-Me | 1.15 | 21-Me | 1.56 | 22-Hb | | 23-Ha | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 1.32 | 27-Me | 1.32 | 28-Me | 1.07 (d, 6) |
|
| |
M.P. | 283-285°C | [α]D20 | | IR (KBr) ν max (cm-1) | 1690 (cyclohexenone) | UV (EtOH) λ max (log ε) | 240 (4.056) |
| |
HPTLC | | TLC | NP-TLC on silicagel Rf 0.20 (CHCl3-EtOH 4:1) (makisterone A 0.16); Rf 0.27 (CHCl3-EtOH 4:1); RP-TLC on paraffin coated silica gel Rf 0.37 (MeOH-H2O 50:50); RP-TLC on C18-bonded silica gel Rf 0.39 (MeOH-H2O 65:35) | GLC | Ret 9.85 min on 1.5% OV101 (0.9 m x 4.5 mm i.d.) at 285°C after silylation at 140°C | HPLC | |
| |
| |
|
Permanent link to this datasheet: DACRYSTERONE
|
|