|
|
|
|
Year of first isolation: |
1986 |
| Formula: | C43H72O7 |
| Molecular weight: | 700 |
| Occurence in plants: |
|
|
| Occurence in animals: |
Boophilus microplus [Ixodidae] »  ![Wikipedia: Boophilus microplus [Ixodidae]](/images/wikipedia.png)
|
|
| |
| Canonical SMILES | CCCCCCC=CCCCCCCCC(=O)OC(CCC(C)(C)O)C(C)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O | Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)OC(=O)CCCCCCC/C=CCCCCCC)O)C)C » 
| | IUPAC Name | [(2S)-6-hydroxy-6-methyl-2-[(2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-yl] (Z)-hexadec-9-enoate | | CAS-RN | | | PubChem CID | 66869189 | InChiKey
[ ChemIDPlus: search ] | DQQCDNDQVOUFJJ-NTUVOCFPSA-N | | InChI | InChI=1S/C43H72O7/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-39(47)50-38(23-24-40(3,4)48)30(2)31-22-26-43(49)33-27-35(44)34-28-36(45)37(46)29-41(34,5)32(33)21-25-42(31,43)6/h12-13,27,30-32,34,36-38,45-46,48-49H,7-11,14-26,28-29H2,1-6H3/b13-12-/t30-,31+,32-,34-,36+,37-,38?,41+,42+,43+/m0/s1 |
| |
| CI-MS (NH3) m/z | | | EI-MS m/z (relative intensity %) | | | FAB-MS (matrix tetraethyleneglycol TEG) m/z (relative intensity %) | 895 (M+H+ TEG)+ (3), 701 (M+H)+ (8), 683 (38), 665 (4), 447 (12), 429 (100), 411 (66), 393 (13). | | HR-MS | |
|
|
| C5D5N | | 01 | | | 02 | | | 03 | | | 04 | | | 05 | | | 06 | | | 07 | | | 08 | | | 09 | | | 10 | | | 11 | | | 12 | | | 13 | | | 14 | | | 15 | | | 16 | | | 17 | | | 18 | | | 19 | | | 20 | | | 21 | | | 22 | | | 23 | | | 24 | | | 25 | | | 26 | | | 27 | |
|
| CDCl3 | | 01-Ha | | | 01-He | | | 02-Ha | 3.92 (m, w1/2=22) | | 03-He | 4.05 (m, w1/2=13) | | 04-Ha | | | 04-He | | | 05-H | | | 07-H | 5.855 (d, 2) | | 09-Ha | | | 11-Ha | | | 11-He | | | 12-Ha | | | 12-He | | | 14-H | | | 15-Ha | | | 15-Hb | | | 16-Ha | | | 16-Hb | | | 17-H | | | 18-Me | 0.678 (s ) | | 19-Me | 0.993 (s ) | | 21-Me | 0.950 (d, 7) | | 22-H | 4.89 (m, w1/2=18) | | 23-Ha | | | 23-Hb | | | 24-Ha | | | 24-Hb | | | 25-H | | | 26-Me | 1.233 (s ) | | 27-Me | 1.233 (s ) |
|
| |
| M.P. | | | [α]D20 | | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | |
| |
| HPTLC | | | TLC | | | GLC | (of fatty acid methyl ester) | | HPLC | 1- Retention time 24.5 min [Partisil 5 (Whatman), 250 mm x 4.6 mm i.d., solvent dichloroethane-iPrOH-H2O 125:24:1 v/v/v, flow-rate 1 ml.min-1]. 2-Retention time 14.5 min [ Ultrasphere-ODS (Beckman) 250 mm x 4.6 mm i.d., solvent linear gradient (30 min) of MeOH in H2O from 9:1 to 1:0 v/v, flow-rate 1 ml.min-1] |
| |
| |
| |
Permanent link to this datasheet: ECDYSONE 22-PALMITOLEATE
|
|
