|
|
|
|
Year of first isolation: |
2009 |
| Formula: | C23H30O5 |
| Molecular weight: | 386 |
| Occurence in plants: |
Cyanotis longifolia [Commelinaceae] » ![Wikipedia: Cyanotis longifolia [Commelinaceae]](/images/wikipedia.png)
|
| Occurence in animals: |
|
|
|
| |
| Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1OC(=O)C)O)C(=O)C=C1[C@@H]2CC[C@]2(C1=CC[C@@H]2C(=O)C)C)C » 
| | IUPAC Name | (2S,3R,5R,9R,10R,13R,17S)-17-acetyl-3-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,6,9,10,11,12,13,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-2-yl acetate | | CAS-RN | | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | REXTZPYJFANSJQ-RPVMLSHBSA-N | | InChI | InChI=1S/C23H30O5/c1-12(24)15-5-6-16-14-9-19(26)18-10-20(27)21(28-13(2)25)11-23(18,4)17(14)7-8-22(15,16)3/h6,9,15,17-18,20-21,27H,5,7-8,10-11H2,1-4H3/t15-,17+,18+,20-,21+,22-,23-/m1/s1 |
| |
| HR-MS | | | EI-MS m/z (relative intensity %) | | | CI-MS (NH3) m/z | 404[M+NH4]+, 387[MH]+, 344 [M+NH4-CH3COOH]+ |
|
|
| D2O | | 01 | 35.1 | | 02 | 74.4 | | 03 | 68.2 | | 04 | n.d. | | 05 | 52.7 | | 06 | n.d. | | 07 | 122.9 | | 08 | n.d. | | 09 | 41.3 | | 10 | 41.6 | | 11 | 23.1 | | 12 | 40.7 | | 13 | 50.8 | | 14 | 149.6 | | 15 | 133.8 | | 16 | n.d. | | 17 | 61.7 | | 18 | 21.1 | | 19 | 25.5 | | 20 | 219.1 | | 21 | 33.2 | | Ac [CH3] | 23.4 | | Ac [CO] | 175.7 |
|
| D2O | | 01-Ha | 1.56 (t, 13) | | 01-He | 1.99 | | 02-Ha | 5.05 (m, w1/2 = 22) | | 03-He | 4.21 (m, w1/2 = 8) | | 04-Ha | 1.78 | | 04-He | 1.89 | | 05-H | 2.42 | | 07-H | 6.25 (d, 2.6) | | 09-H | 2.92 (m, w1/2 = 25) | | 11-Ha | 1.80* | | 11-He | 1.97* | | 12-Ha | 1.91* | | 12-He | 2.36* | | 15-Ha | 6.21 (s, br, w1/2 = 7) | | 16-Ha | 1.43* | | 16-Hb | 2.84* (dd, 18.5, 11.2) | | 17-H | 3.34 (t, 9.9) | | 18-Me | 0.85 (s) | | 19-Me | 1.017 (s) | | 21-Me | 2.296 (s) | | CH3CO | 2.13 (s) |
|
| |
| M.P. | °C ; | | [α]D20 | ° (c ; MeOH) | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | () ; |
| |
| RP-HPLC | column YMC C18, 250 mm x 20.2 mm i.d, solvent MeOH/H2O 1:1, flow-rate 10 ml/min, Ret 30.6 min (20E : 12.4 min) | | HPLC | | | NP-HPLC | column Zorbax-SIL 250 mm x 4.6 mm i.d., solvent cyclohexane-isopropanol-water, flow-rate 1 mL/min, Ret 4.2 min (20E : 15.8 min) | | TLC | |
| |
| |
| |
Permanent link to this datasheet: 14(15)-DEHYDROPOSTSTERONE 2-ACETATE
|
|