|
|
Year of first isolation: |
1975 |
Formula: | C27H44O8 |
Molecular weight: | 496 |
Occurence in plants: |
Serratula sogdiana [Asteraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)O)CO)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O)C)CO » 
| IUPAC Name | (2S,3R,5R,9R,10S,13R,14S,17S)-2,3,14-trihydroxy-10-(hydroxymethyl)-13-methyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | 58347-83-4 | PubChem CID | 102239711 | InChiKey [ ChemIDPlus: search ] | VZAYBJKRPIYQJN-QUOJMMGDSA-N | InChI | InChI=1S/C27H44O8/c1-23(2,33)8-7-22(32)25(4,34)21-6-10-27(35)16-11-18(29)17-12-19(30)20(31)13-26(17,14-28)15(16)5-9-24(21,27)3/h11,15,17,19-22,28,30-35H,5-10,12-14H2,1-4H3/t15-,17-,19+,20-,21-,22+,24+,25+,26-,27+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 478 (M -18)+, 460 (M -2x18), 442, 424, 409 (M - 4x18 - 15), 406, 379, 361, 343, 325, 99, 81, 69 | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | 4.07-4.04 | 03-He | 4.07-4.04 | 04-Ha | | 04-He | | 05-H | | 07-H | 6.15 | 09-Ha | 3.50 | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 1.06 (s ) | 19-Me | | 21-Me | 1.46 (s ) | 22-H | 3.75 (m ) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.25 (s ) | 27-Me | 1.25 (s ) |
CDCl3 | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.80 (s ) | 19-Me | | 21-Me | 1.22 (s ) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.15 (s ) | 27-Me | 1.18 (s ) |
|
| |
M.P. | | [α]D20 | + 43.9 ° (c 0.41; MeOH) | IR (KBr) ν max (cm-1) | 3300-3550 (OH), 1665 (cyclohexenone) | UV (EtOH) λ max (log ε) | 242 (3.98) |
| |
| |
| |
|
Permanent link to this datasheet: SOGDISTERONE
|
|