|
|
Year of first isolation: |
1979 |
Formula: | C27H44O5 |
Molecular weight: | 448 |
Occurence in plants: |
Silene praemixta [Caryophyllaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H](C1)O)C(=O)CC1=C2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)O)O)C)C » 
| IUPAC Name | | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | ZBHXMNUVFBOPTI-CPMVCBKASA-N | InChI | InChI=1S/C27H44O5/c1-16(22(29)9-10-24(2,3)31)18-8-13-27(32)20-15-23(30)21-14-17(28)6-11-25(21,4)19(20)7-12-26(18,27)5/h16-18,21-22,28-29,31-32H,6-15H2,1-5H3/t16-,17-,18+,21-,22+,25+,26+,27+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 448 (M)+ (1), 430 (11), 415 (4), 412 (7), 397 (5), 394 (3), 379 (2), 361 (10), 343 (6), 332 (5), 314 (5), 303 (4), 299 (4), 285 (7), 284 (4), 277 (33), 234 (18), 233 (14), 215 (16), 99 (100), 81 (37). | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | 4.09 | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.81 | 19-Me | 0.98 | 21-Me | 1.09 | 22-H | 3.72 | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.30 | 27-Me | 1.30 |
|
| |
M.P. | 110-112 °C | [α]D24 | 0 ? 4° (c 0.85; MeOH) | IR (KBr) ν max (cm-1) | 3415 (OH), 1710 (CO) | UV (EtOH) λ max (log ε) | 202 (3.35) |
| |
HPTLC | | TLC | TLC on silica gel : Rf 0.43 (CHCl3-EtOH 9:1) | GLC | | HPLC | |
| |
| |
|
Permanent link to this datasheet: PRAEMIXISTERONE
|
|