|
|
Year of first isolation: |
2018 |
Formula: | C29H44O8 |
Molecular weight: | 520 |
Occurence in plants: |
|
Occurence in animals: |
Antipathozoanthus hickmani [Parazoanthidae] »
|
|
| |
Canonical SMILES | CC(C)C(CC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC5(CC(=O)OC5C4)O)C)C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@@H]3[C@]1(CC(=O)O3)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](C[C@@H](C(C)C)O)O)O)O)C)C »
| IUPAC Name | (1R,2R,4S,8R,10R,14S,17S,18R)-4,14-dihydroxy-2,18-dimethyl-17-[(2R,3R,5S)-2,3,5-trihydroxy-6-methylheptan-2-yl]-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-ene-6,11-dione | CAS-RN | | PubChem CID | 138453999 | InChiKey [ ChemIDPlus: search ] | UCAGFQCTZONODQ-RCRUPTEMSA-N | InChI | InChI=1S/C29H44O8/c1-15(2)19(30)12-22(32)27(5,34)21-7-9-29(36)17-10-20(31)18-11-23-28(35,13-24(33)37-23)14-25(18,3)16(17)6-8-26(21,29)4/h10,15-16,18-19,21-23,30,32,34-36H,6-9,11-14H2,1-5H3/t16-,18-,19-,21-,22+,23+,25+,26+,27+,28+,29+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | HRESI-MS m/z (positive ion mode) m/z | 521.3104 [M+H] + , calc. for C29H45O8 521.3109 (∆ -0.96 ppm) |
|
|
CD3OD | 01 | 41.0 | 02 | 74.0 | 03 | 82.1 | 04 | 25.8 | 05 | 52.1 | 06 | 203.7 | 07 | 121.6 | 08 | 169.2 | 09 | 35.7 | 10 | 37.0 | 11 | 21.4 | 12 | 32.5 | 13 | 48.7 | 14 | 85.0 | 15 | 31.9 | 16 | 21.5 | 17 | 50.4 | 18 | 18.1 | 19 | 24.1 | 20 | 77.8 | 21 | 20.9 | 22 | 77.6 | 23 | 35.7 | 24 | 77.5 | 25 | 34.1 | 26 | 19.5 | 27 | 17.0 |
01' | 176.0 |
02' | 47.4 |
|
CD3OD | 01-Ha | 2.13 (m) | 01-Hb | 1.10 (d, 15.0) | 02-H | | 03-He | 4.40 (br, s) | 04-Ha | 2.11 (m) | 04-Hb | 1.93 (m) | 05-H | 2.11 (m) | 07-H | 5.83 (d, 2.0) | 09-H | 3.80 (br dd, 11.5, 6.5) | 11-Ha | 1.93 (m) | 11-Hb | 1.64 (m) | 12-Ha | 2.14 (m) | 12-Hb | 1.84 (td, 13.5, 3.5) | 15-Ha | 1.93 (m) | 15-Hb | 1.61 (m) | 16-Ha | 1.99 (m) | 16-Hb | 1.71 (m) | 17-H | 2.34 (m) | 18-Me | 0.89 (s) | 19-Me | 0.95 (s) | 21-Me | 1.21 (s) | 22-H | 3.59 (m) | 23-Ha | 1.71 (m) | 23-Hb | 1.34 (m) | 24-H | 3.59 (m) | 25-H | 1.69 (m) | 26-Me | 0.95 (d, 7.0) | 27-Me | 0.91 (d, 7.0) |
2'a | 2.70 (d, 16.5) |
2'b | 2.49 (d, 16.5) |
|
| |
M.P. | °C ; | [α]D20 | +29 ° (c 0.1; MeOH) | IR (KBr) ν max (cm-1) | | UV (DAD) λ max (log ε) | 240 () ; |
| |
| |
| |
|
Permanent link to this datasheet: ECDYSONELACTONE D
|
|