|
|
|
|
Year of first isolation: |
1984 |
| Formula: | C29H47O10P |
| Molecular weight: | 586 |
| Occurence in plants: |
|
|
| Occurence in animals: |
Schistocerca gregaria [Orthoptera] »  ![Wikipedia: Schistocerca gregaria [Orthoptera]](/images/wikipedia.png)
|
|
| |
| Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)OC(=O)C)OP(=O)(O)O)C)C)O)C(CCC(C)(C)O)O | Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | C[C@@H]([C@H]1CC[C@@]2([C@@]1(CC[C@H]3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)OC(=O)C)OP(=O)(O)O)C)C)O)[C@@H](CCC(C)(C)O)O » 
| | IUPAC Name | [(2S,3R,5R,9R,10R,13R,14S,17R)-17-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-10,13-dimethyl-6-oxo-2-phosphonooxy-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | | CAS-RN | | | PubChem CID | 23657836 | InChiKey
[ ChemIDPlus: search ] | MYOZIWALDKJCBG-KXCOSXAXSA-N | | InChI | InChI=1S/C29H47O10P/c1-16(22(31)9-10-26(3,4)33)18-8-12-29(34)20-13-23(32)21-14-24(38-17(2)30)25(39-40(35,36)37)15-27(21,5)19(20)7-11-28(18,29)6/h13,16,18-19,21-22,24-25,31,33-34H,7-12,14-15H2,1-6H3,(H2,35,36,37)/t16-,18+,19-,21-,22+,24+,25-,27+,28+,29+/m0/s1 |
| |
| CI-MS (NH3) m/z | | | EI-MS m/z (relative intensity %) | | | FAB-MS m/z | 585 (M-H)-, 97 (H2PO4)-, 79 (PO3)- | | HR-MS | |
|
|
| C5D5N | | 01 | | | 02 | | | 03 | | | 04 | | | 05 | | | 06 | | | 07 | | | 08 | | | 09 | | | 10 | | | 11 | | | 12 | | | 13 | | | 14 | | | 15 | | | 16 | | | 17 | | | 18 | | | 19 | | | 20 | | | 21 | | | 22 | | | 23 | | | 24 | | | 25 | | | 26 | | | 27 | |
|
| CD3OD | | 01-Ha | | | 01-He | | | 02-Ha | | | 03-He | | | 04-Ha | | | 04-He | | | 05-H | 5.82 | | 07-H | | | 09-Ha | | | 11-Ha | | | 11-He | | | 12-Ha | | | 12-He | | | 15-Ha | | | 15-Hb | | | 16-Ha | | | 16-Hb | | | 17-H | | | 18-Me | 0.73 (s ) | | 19-Me | 1.00 (s ) | | 20-H | | | 21-Me | 0.94 (d, 6) | | 22-H | 3.58 (m, w1/2=16) | | 23-Ha | | | 23-Hb | | | 24-Ha | | | 24-Hb | | | 26-Me | 1.19 (s ) | | 27-Me | 1.20 (s ) | | O-Ac | 2.09 (s ) |
|
| |
| M.P. | | | [α]D20 | | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | |
| |
| HPTLC | | | TLC | | | GLC | | | HPLC | 1-Retention volume 50 ml [column Partisil-ODS3, 25 cm long, 4.6 mm i.d., eluted with a linear gradient (30 min) of MeOH in 20 mM sodium citrate, pH 6.5, from 1:9 to 7:3, flow-rate 2 ml.min-1]; 2-Retention volume 35 ml [column Partisil-ODS3, 25 cm long, 4.6 mm i.d., eluted with a linear gradient (30 min) of MeOH in H2O from 1:19 to 1:1, flow rate 2 ml.min-1]; 3-Ret-ention volume 30 ml [column Partisil-SAX, 25 cm long, 4.6 mm i.d., eluted with 0.1M ammonium acetate, flow rate 2 ml.min-1] |
| |
| |
| |
Permanent link to this datasheet: ECDYSONE 3-ACETATE 2-PHOSPHATE
|
|
