|
|
Year of first isolation: |
2022 |
Formula: | C28H46O6 |
Molecular weight: | 478 |
Occurence in plants: |
Aspergillus puniceus [Fungi] » ![Wikipedia: Aspergillus puniceus [Fungi]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C[C@@]12[C@@](C(C=C3C2CC[C@@]4(C)[C@@]3(O)CC[C@@]4([C@](C)([C@H](O)C[C@@H](C)C(C)C)O)[H])=O)([H])C[C@@H](O)[C@@H](O)C1 » ![JSMol: View in 3D](/images/3D.png)
| IUPAC Name | (2S,3R,5R,10R,13R,14S,17S)-17-((2R,3R,5R)-2,3-dihydroxy-5,6-dimethylheptan-2-yl)-2,3,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | KQBCIGPPRFLKLS-YVOHVHGBSA-N | InChI | InChI=1S/C28H46O6/c1-15(2)16(3)11-24(32)27(6,33)23-8-10-28(34)18-12-20(29)19-13-21(30)22(31)14-25(19,4)17(18)7-9-26(23,28)5/h12,15-17,19,21-24,30-34H,7-11,13-14H2,1-6H3/t16-,17?,19+,21-,22+,23+,24-,25-,26-,27-,28-/m1/s1 |
| |
HRESIMS (positive ion mode) m/z
| 479.3367 (M+H)+, calculated for C28H47O6 479.3367 |
|
|
DMSO-d6 | 01 | 36.6 | 02 | 66.8 | 03 | 66.6 | 04 | 31.5 | 05 | 50.1 | 06 | 202.7 | 07 | 120.4 | 08 | 165.2 | 09 | 33.1 | 10 | 37.6 | 11 | 20.0 | 12 | 30.9 | 13 | 46.8 | 14 | 83.0 | 15 | 30.3 | 16 | 20.0 | 17 | 48.6 | 18 | 17.1 | 19 | 23.9 | 20 | 75.7 | 21 | 20.8 | 22 | 72.9 | 23 | 35.7 | 24 | 34.3 | 25 | 32.8 | 26 | 18.3 | 27 | 19.9 | 28 | 14.7 |
|
DMSO-d6 | 01-Ha | 1.26 (t, 12.6) | 01-Hb | 1.60 (m) | 02-Ha | 3.60 (m) | 03-He | 3.76 (br, s) | 04-Ha | 1.47 | 04-Hb | 1.57 | 05-H | 2.19 | 07-H | 5.62 (d, 2.1) | 09-H | 3.00 (t, 8.2) | 11-Ha | 1.53 | 11-Hb | 1.65 (m) | 12-Ha | 1.71 (m) | 12-Hb | 2.01 (td, 12.8, 4.5) | 15-Ha | 1.51 | 15-Hb | 1.79 (m) | 16-Ha | 1.53 (m) | 16-Hb | 1.89 (dd, 20.1, 10.2) | 17-H | 2.21 | 18-Me | 0.76 (s) | 19-Me | 0.83 (s) | 21-Me | 1.05 (s) | 22-H | 3.25 (dd, 10.2, 5.3) | 23-Ha | 1.03 | 23-Hb | 1.15 (t, 11.1) | 24-H | 1.55 | 25-H | 1.49 | 26-Me | 0.79 (d, 6.7) | 27-Me | 0.83 (d, 6.6) | 28-Me | 0.76 (d, 6.4) | [02-OH] | 4.44 (d, 5.9) | [03-OH] | 4.36 (d, 2.8) | [14-OH] | 4.64 (s) | [20-OH] | 3.59 (s) | [22-OH] | 4.32 (d, 5.4) |
|
| |
M.P. | 279-281 °C ; | [α]D25 | +73° (c 0.1 ; MeOH) | IR (film) ν max (cm-1) | 3317, 2943, 2833, 1665, 1448, 1414, 1113, 1022, 667 | UV (MeOH) λ max (log ε) | 243 nm (3.98) |
| |
| |
| |
|
Permanent link to this datasheet: PUNICESTERONE D
|
|