|
|
Year of first isolation: |
1985 |
Formula: | C30H44O9 |
Molecular weight: | 548 |
Occurence in plants: |
Ajuga reptans [Lamiaceae (alt. Labiatae)] » ![Wikipedia: Ajuga reptans [Lamiaceae (alt. Labiatae)]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1C(COC1=O)CC(C(C)(C2CCC3(C2(CCC4C3=CC(=O)C5C4(CC(C(C5)OC(=O)C)O)C)C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)OC(=O)C)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@H](O)C[C@@H]1COC(=O)[C@H]1C)O)O)C)C » 
| IUPAC Name | [(2S,3R,5R,9R,10R,13R,14S,17S)-17-[(2R,3R)-2,3-dihydroxy-4-[(3S,4S)-4-methyl-5-oxooxolan-3-yl]butan-2-yl]-2,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | CAS-RN | | PubChem CID | 152756033 | InChiKey [ ChemIDPlus: search ] | PEHHOWZJLAZZNB-CCQDXIEQSA-N | InChI | InChI=1S/C30H44O9/c1-15-17(14-38-26(15)35)10-25(34)29(5,36)24-7-9-30(37)19-11-21(32)20-12-23(39-16(2)31)22(33)13-27(20,3)18(19)6-8-28(24,30)4/h11,15,17-18,20,22-25,33-34,36-37H,6-10,12-14H2,1-5H3/t15-,17+,18-,20-,22-,23+,24-,25+,27+,28+,29+,30+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 548 (M)+ (1.9), | HR-MS | |
|
|
C5D5N | 01 | 38.70 * | 02 | 66.07 | 03 | 71.20 | 04 | 29.65 | 05 | 51.93 | 06 | 202.15 | 07 | 121.55 | 08 | 166.28 | 09 | 34.40 | 10 | 38.57 * | 11 | 21.07 | 12 | 31.78 | 13 | 48.14 | 14 | 84.05 | 15 | 31.94 | 16 | 21.35 | 17 | 50.11 | 18 | 17.88 | 19 | 24.26 | 20 | 76.64 | 21 | 21.26 " | 22 | 75.97 | 23 | 34.75 | 24 | 40.68 | 25 | 43.32 | 26 | 179.78 | 27 | 14.44 | 28 | 72.89 | CH3COO | 21.07 ", 170.56 |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | 4.28 (br, d, w1/2 = 21.0) | 03-He | 5.49 (br, w1/2 = 9.0) | 04-Ha | | 04-He | | 05-H | 2.67 (dd, 13.5, 4.2) | 07-H | 6.26 (d, 1.8) | 09-Ha | 3.59 (bt, w1/2 = 23.0) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | 2.87 (bt, 9.0) | 18-Me | 1.24 (s ) | 19-Me | 1.08 (s ) | 21-Me | 1.57 (s ) | 22-H | 3.89 (brd, w1/2 = 19.6) | 23-Ha | | 23-Hb | | 24-H | | 25-H | 2.22 (dq, 10.8, 6.9) | 26-Me | - | 27-Me | 1.16 (d, 6.9) | 28-Ha | 4.65 (dd, ca. 9.2, 7.6) | 28-Hb | 3.96 (dd, ca. 10.4, 8.8) | O-Ac | 1.96 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | HPLC | RP-HPLC, Column LiChroCART 4x125 mm packed with Lichrospher 100 RP-18, 5?m, with a guard column Waters 4x24 mm packed with Bondapak C-18, 10 ?m, temperature 55°C, solvent iPrOH-H2O 1:10, flow-rate 1 ml.min-1. Ret 15.68 min. |
| |
| |
|
Permanent link to this datasheet: 29-NORCYASTERONE 3-ACETATE
|
|