|
|
Year of first isolation: |
2008 |
Formula: | C33H54O11 |
Molecular weight: | 626 |
Occurence in plants: |
Leuzea carthamoides [Asteraceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C)CCC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)C)O[C@@H]1OC([C@H](C(C1O)O)O)CO)O)O)C)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14R,17S)-2,3,14-trihydroxy-17-[(2R,3R)-2-hydroxy-6-methyl-3-[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 101851583 | InChiKey [ ChemIDPlus: search ] | UPMZPXAMHPZSQX-WIKHOFDESA-N | InChI | InChI=1S/C33H54O11/c1-16(2)6-7-25(44-29-28(40)27(39)26(38)23(15-34)43-29)32(5,41)24-9-11-33(42)18-12-20(35)19-13-21(36)22(37)14-30(19,3)17(18)8-10-31(24,33)4/h12,16-17,19,21-29,34,36-42H,6-11,13-15H2,1-5H3/t17-,19-,21+,22-,23+,24-,25+,26+,27-,28+,29-,30+,31+,32+,33-/m0/s1 |
| |
ESI-MS/MS m/z | 627 [M+H]+, 609 [M+H-H2O]+, 591 [M+H-2H2O]+, 573 [M+H-3H2O]+, 465 [M+H-C6H10O5]+, 447 [M+H-H2O-C6H10O5]+, 429 [M+H-2H2O-C6H10O5]+, 411 [M+H-3H2O-C6H10O5]+, 347, 329, 303, 145 | HR-ESI-MS m/z | 627.3758 [M+H]+ (calculated for C33H55O11: 627.3758) |
|
|
CD3OD | 01 | 37.22 | 02 | 68.67 | 03 | 68.39 | 04 | 32.90 | 05 | 50.98 | 06 | 206.22 | 07 | 123.14 | 08 | 167.38 | 09 | 37.25 | 10 | 39.21 | 11 | 22.20 | 12 | 41.90 | 13 | 52.77 | 14 | 85.47 | 15 | 41.14 | 16 | 24.43 | 17 | 57.30 | 18 | 19.37 | 19 | 24.67 | 20 | 77.07 | 21 | 21.83 | 22 | 90.44 | 23 | 31.00 | 24 | 36.44 | 25 | 29.36 | 26 | 22.84 | 27 | 23.25 | [Glu] 1´ | 105.95 | [Glu] 2´ | 75.27 | [Glu] 3´ | 77.94 | [Glu] 4´ | 77.90 | [Glu] 5´ | 71.41 | [Glu] 6´ | 62.31 |
|
CD3OD | 01-Ha | 1.43 (dd, 13.2, 12.0) | 01-He | 1.80 (dd, 13.3, 4.2) | 02-Ha | 3.86 (ddd, 12.0, 4.2, 3.0) | 03-He | 3.94 (q, 3, 3, 3) | 04-Ha | 1.73 | 04-He | 1.60 | 05-H | 2.36 (dd, 13.2, 4.0) | 07-H | 6.32 (dd, 2.4, 0.8) | 09-Ha | 2.85 (m) | 11-Ha | 1.66 | 11-He | 1.79 | 12-Ha | 1.75 | 12-He | 1.69 | 15-Ha | 2.28 | 15-Hb | 1.43 | 16-Ha | 1.86 | 16-Hb | 2.08 | 17-H | 1.91 | 18-Me | 1.26 (s) | 19-Me | 0.94 (s) | 21-Me | 1.32 (s) | 22-H | 3.58 (dd, 10.0, 1.5) | 23-Ha | 1.57 | 23-Hb | 1.48 | 24-Ha | 1.74 | 24-Hb | 1.24 | 25-H | 1.56 | 26-Me | 0.93 (d, 6.8) | 27-Me | 0.93 (d, 6.8) | [Glu] 1' | 4.34 (d, 7.8) | [Glu] 2' | 3.26 (dd, 7.8, 8.8) | [Glu] 3' | ~3.36 (m) | [Glu] 4' | ~3.36 (m) | [Glu] 5' | ~3.36 (m) | [Glu] 6'a | 3.69 (dd, 11.8, 5.5) | [Glu] 6'b | 3.87 (dd, 11.8, 1.8) |
|
| |
M.P. | °C ; | [α]D20 | + 59.2 ° (c 0.03; EtOH) | IR (KBr) ν max (cm-1) | 3413 (OH), 1652 (C=O), 1099, 1071, 1056, 1030 (C-O) | UV (MeOH) λ max (log ε) | |
| |
HPLC | | NP-HPLC | column Silasorb 600 (5 micro m, 250 x 4 mm) solvent dichloromethane-isopropanol-water (84:15:1), flow-rate 0.8 ml/min . Retention time 88.8 min (20E 90.9 min); and two other solvent systems. | RP-HPLC | column Separon SGX C-18 (5 micro m, 250 x 4 mm), solvent methanol-water (linear grad of 10-70%), flow-rate 0,6 ml/min. Retention time 47.3 min (20E 34.2 min); | GLC | | HPTLC | | TLC | |
| |
| |
|
Permanent link to this datasheet: 14-EPI-PONASTERONE A 22-GLUCOSIDE
|
|