|
|
Year of first isolation: |
1971 |
Formula: | C45H74O17 |
Molecular weight: | 886 |
Occurence in plants: |
Polypodium vulgare [fern] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1CCC(OC1OC2C(C(C(C(O2)C)O)O)O)C(C)C3CCC4C3(CCC5C4CC(=O)C6C5(CCC(C6)OC7C(C(C(C(O7)CO)O)O)OC8C(C(C(C(O8)C)O)O)O)C)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]4([C@H](C[C@H](C1)O[C@H]2C(C([C@@H](C(O2)CO)O)O)O[C@H]3C(C([C@H](C(O3)C)O)O)O)C(=O)C[C@@H]5[C@@H]4CC[C@]6([C@H]5CC[C@@H]6[C@H](C)[C@H]7CC[C@@H]([C@H](O7)O[C@H]8C(C([C@H](C(C8)C)O)O)O)C)C)C » 
| IUPAC Name | (3S,5S,8S,9S,10R,13S,14S)-3-[(2R,3R,4S,5S,6R)-4,5-dihydroxy-6-(hydroxymethyl)-3-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]oxy-10,13-dimethyl-17-[(1S)-1-[(5R,6R)-5-methyl-6-[(2S,3R,4R,5R,6S)-3,4,5-trihydroxy-6-methyloxan-2-yl]oxyoxan-2-yl]ethyl]-1,2,3,4,5,7,8,9,11,12,14,15,16,17-tetradecahydrocyclopenta[a]phenanthren-6-one | CAS-RN | 33650-66-7 | PubChem CID | 441890 | InChiKey [ ChemIDPlus: search ] | QZOALWMSYRBZSA-XSAMIUIESA-N | InChI | InChI=1S/C45H74O17/c1-18-7-10-29(59-40(18)62-42-38(55)35(52)32(49)21(4)57-42)19(2)24-8-9-25-23-16-28(47)27-15-22(11-13-45(27,6)26(23)12-14-44(24,25)5)58-43-39(36(53)33(50)30(17-46)60-43)61-41-37(54)34(51)31(48)20(3)56-41/h18-27,29-43,46,48-55H,7-17H2,1-6H3/t18-,19+,20+,21+,22+,23+,24?,25+,26+,27-,29?,30-,31+,32+,33-,34-,35-,36+,37-,38-,39-,40-,41+,42+,43-,44-,45-/m1/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %), data for the aglycone | 432 (M)+ (1.8), 416 (M-18)+ (61), 345 (26), 317 (63), 299 (38), 287 (84), 126 (77), 115 (56), 97 (100) | HR-FAB-MS | 909 (M+Na) |
|
|
C5D5N | 01 | 36.8 | 02 | 29.4 | 03 | 76.2 | 04 | 26.5 | 05 | 56.3 | 06 | 209.6 | 07 | 46.8 | 08 | 36.5 | 09 | 53.8 | 10 | 40.9 | 11 | 27.3 | 12 | 39.7 | 13 | 43.2 | 14 | 56.4 | 15 | 24.1 | 16 | 21.6 | 17 | 52.8 | 18 | 13.1 | 19 | 11.9 | 20 | 40.1 | 21 | 13.7 | 22 | 78.3 | 23 | 23.9 | 24 | 31.5 | 25 | 37.8 | 26 | 107.3 | 27 | 16.7 | 2x[rha]1 | 102.1 / 101.9 | 2x[rha]2 | 72.5 / 72.2 | 2x[rha]3 | 72.8 / 72.8 | 2x[rha]4 | 74.1 / 74.0 | 2x[rha]5 | 69.5 / 70.7 | 2x[rha]6 | 18.7 / 18.4 | [glu]1 | 99.6 | [glu]2 | 78.2 | [glu]3 | 79.5 | [glu]4 | 72.0 | [glu]5 | 78.3 | [glu]6 | 62.8 |
|
C5D5N | 01-He | 1.02 / 1.59 | 02-Ha | 2.09 / 1.80 | 03-He | 4.0 | 04-Ha | 2.49 | 04-He | 1.94 | 05-H | 2.01 | 07-H | 2.00 / 2.37 | 09-Ha | 1.10 | 11-Ha | 1.57 | 11-He | 1.20 | 12-Ha | 1.89 | 12-He | 1.08 | 15-Ha | 0.94 | 15-Hb | 1.41 | 16-Ha | 1.20 | 16-Hb | 1.46 | 17-H | 1.10 | 18-Me | 0.78 | 19-Me | 0.56 | 20-H | 1.87 | 21-Me | 1.03 | 22-H | 3.46 | 23-Ha | 1.32 | 23-Hb | 1.32 | 24-Ha | 1.76 | 24-Hb | 1.13 | 26-Me | 4.48 | 27-Me | 0.92 | 2x[rha]1 | 6.36 / 5.67 | 2x[rha]2 | 4.80 / 4.63 | 2x[rha]3 | 4.66 / 4.56 | 2x[rha]4 | 4.35 / 4.32 | 2x[rha]5 | 4.98 / 4.67 | 2x[rha]6 | 1.80 / 1.71 | [glu]1 | 5.08 | [glu]2 | 4.27 | [glu]3 | 4.27 | [glu]4 | 4.14 | [glu]5 | 3.92 | [glu]6 | 4.36 / 4.57 |
|
| |
M.P. | 198-199 °C | [α]D20 | -36.2° (c 2.0 , EtOH) | IR (Nujol) ν max (cm-1) | 3400 (OH), 1704 (CO) | UV (EtOH) λ max (log ε) | |
| |
| |
| |
|
Permanent link to this datasheet: OSLADIN
|
|