|
|
Year of first isolation: |
1988 |
Formula: | C33H52O11 |
Molecular weight: | 624 |
Occurence in plants: |
Pfaffia iresinoides [Amaranthaceae] » ![Wikipedia: Pfaffia iresinoides [Amaranthaceae]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)CC1=C2CC[C@]2(C1=CC[C@@H]2[C@@]([C@@H](CCC(C)(C)O[C@H]1C(C([C@@H](C(O1)CO)O)O)O)O)(C)O)C)C » 
| IUPAC Name | (2S,3R,5R,10S,13R,17S)-17-((2R,3R)-2,3-dihydroxy-6-methyl-6-(((2S,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)heptan-2-yl)-2,3-dihydroxy-10,13-dimethyl-1,2,3,4,5,7,10,11,12,13,16,17-dodecahydro-6H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | OGSPMXRKDOGBCR-QGPSJLLLSA-N | InChI | InChI=1S/C33H52O11/c1-30(2,44-29-28(41)27(40)26(39)23(15-34)43-29)10-9-25(38)33(5,42)24-7-6-17-16-12-20(35)19-13-21(36)22(37)14-32(19,4)18(16)8-11-31(17,24)3/h6,19,21-29,34,36-42H,7-15H2,1-5H3/t19-,21+,22-,23?,24-,25+,26+,27?,28?,29-,31-,32+,33+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | FAB-MS m/z | 625 (M+H)+ | HR-MS | |
|
|
C5D5N | 01 | 38.5 | 02 | 69.6 | 03 | 68.3 | 04 | 32.9 | 05 | 53.6 | 06 | 212.4 | 07 | 39.4 | 08 | 122.8 | 09 | 136.3 | 10 | 43.6 | 11 | 23.0 | 12 | 37.4 | 13 | 46.7 | 14 | 148.9 | 15 | 119.6 | 16 | 31.5 | 17 | 56.9 | 18 | 18.7 | 19 | 29.5 | 20 | 76.3 | 21 | 20.8 | 22 | 77.7 | 23 | 26.6 | 24 | 40.0 | 25 | 77.4 | 26 | 27.5 | 27 | 27.6 | s-1' | 98.9 | s-2' | 75.4 | s-3' | 78.8 | s-4' | 72.1 | s-5' | 78.6 | s-6' | 63.5 |
|
C5D5N | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | 4.47 (br s ) | 04-Ha | | 04-He | | 05-H | 3.05 (dd, 12.4, 4.0) | 07-H | 2.89, 3.40 (br d, 21) | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-H | 5.44 (br s ) | 16-Ha | 3.02 (br dd, 16.0, 10.4) | 16-Hb | | 17-H | 2.89 (t, 9.0) | 18-Me | 1.34 (s ) | 19-Me | 1.06 (s ) | 21-Me | 1.54 (s ) | 22-H | 3.84 (br d, 7.8) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 1.42 (s ) | 27-Me | 1.47 (s ) | H-1' | 5.02 (d, 7.4) |
|
| |
M.P. | | [α]D15 | - 18.9 ° (c 1.1; MeOH) | IR (KBr) ν max (cm-1) | 3400 (OH), 1710, 1650 (cyclohexenone) | UV (EtOH) λ max (log ε) | 244 (4.12) |
| |
LC on silica | solvent CHCl3-MeOH-EtOAc-H2O (2:2:4:1, lower phase) | HPTLC | | TLC | Rf 0.32 (CHCl3-MeOH-H2O, 13:7:2, lower phase) | GLC | | HPLC | |
| |
| |
|
Permanent link to this datasheet: PODECDYSONE B 25-O-β-D-GLUCOSIDE
|
|