|
|
Year of first isolation: |
2004 |
Formula: | C21H30O6 |
Molecular weight: | 378 |
Occurence in plants: |
Serratula wolffii [Asteraceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(=O)C1CCC2(C1(CC(C3C2=CC(=O)C4C3(CC(C(C4)O)O)C)O)C)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2[C@@H](C[C@]2([C@]1(CC[C@@H]2C(=O)C)O)C)O)C »
| IUPAC Name | (2S,3R,5R,9R,10R,11R,13R,14S,17S)-17-acetyl-2,3,11,14-tetrahydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 11360938 | InChiKey [ ChemIDPlus: search ] | AXUBMUAOVGJKLY-RUWUBIMMSA-N | InChI | InChI=1S/C21H30O6/c1-10(22)11-4-5-21(27)13-7-14(23)12-6-15(24)16(25)8-19(12,2)18(13)17(26)9-20(11,21)3/h7,11-12,15-18,24-27H,4-6,8-9H2,1-3H3/t11-,12+,15-,16+,17-,18-,19+,20-,21-/m1/s1 |
| |
FAB-MS m/z (relative intensity %) | 379 [M+H]+ (100), 361 [M+H-H2O]+ (88), 343 [M+H-2H2O]+ (40), 325 [M+H-3H2O]+ (10), 299 (11), 282 (32), 277 (13), 246 (80), 231 (20) | HRESI-MS | 378.2045 (calculated 378.2042 for C21H30O6) | EI-MS m/z (relative intensity %) | |
|
|
CD3OD | 01 | 39.2 | 02 | 69.1 | 03 | 68.7 | 04 | 33.5 | 05 | 53.0 | 06 | 206.6 | 07 | 123.3 | 08 | 164.4 | 09 | 43.1 | 10 | 40.1 | 11 | 69.4 | 12 | 42.3 | 13 | 48.6 | 14 | 84.8 | 15 | 32.3 | 16 | 22.4 | 17 | 60.0 | 18 | 18.4 | 19 | 24.8 | 20 | 212.3 | 21 | 31.6 |
|
CD3OD | 01-Ha | 2.60 (dd, 13.0, 4.2) | 01-He | 1.38 (t, 12.3) | 02-Ha | 4.015 (dt, 11.8, 3.8) | 03-He | 3.96 (q, 2.9) | 04-Ha | 1.70 | 04-He | 1.775 (td, 13.6, 2.4) | 05-H | 2.345 (dd, 13.1, 4.1) | 07-H | 5.807 (d, 2.7) | 09-H | 3.18 (dd, 8.9, 2.7) | 11-Ha | 4.08 (ddd, 10.8, 8.9, 5.8) | 12-Ha | 2.406 (t, 11.4) | 12-He | 2.08 (dd, 12.0, 5.8) | 15-Ha | 1.68 | 15-Hb | 2.00 | 16-Ha | 1.90 | 16-Hb | 2.245 | 17-H | 3.36 (dd, 9.4, 8.1) | 18-Me | 0.61 (s) | 19-Me | 1.05 (s) | 21-Me | 2.16 (s) |
|
| |
M.P. | 174-176 °C ; | [α]D28 | + 12 ° (c 0.1 ; MeOH) | IR (KBr) ν max (cm-1) | 3320, 1718, 1653 | UV (MeOH) λ max (log ε) | 240 (4.116) ; |
| |
LC | Low pressure RP, MeOH-H2O (40:60) | HPLC | | GLC | | TLC | |
| |
| |
|
Permanent link to this datasheet: 11α-HYDROXYPOSTSTERONE
|
|