|
|
Year of first isolation: |
1987 |
Formula: | C33H54O12 |
Molecular weight: | 642 |
Occurence in plants: |
|
Occurence in animals: |
Manduca sexta [Lepidoptera] »
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(CO)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(CO)(C)O)O[C@@H]1C(C([C@@H](C(O1)CO)O)O)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(CO)(C)O)O[C@@H]1C(C([C@@H](C(O1)CO)O)O)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(CO)(C)O)O[C@@H]1C(C([C@@H](C(O1)CO)O)O)O)O)C)C »
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17R)-17-[(2S)-6,7-dihydroxy-6-methyl-3-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-2,3,14-trihydroxy-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 66869970 | InChiKey [ ChemIDPlus: search ] | GCANLORBMXWZOZ-DOWCWXDGSA-N | InChI | InChI=1S/C33H54O12/c1-16(24(7-8-30(2,42)15-35)44-29-28(41)27(40)26(39)25(14-34)45-29)17-6-10-33(43)19-11-21(36)20-12-22(37)23(38)13-31(20,3)18(19)5-9-32(17,33)4/h11,16-18,20,22-29,34-35,37-43H,5-10,12-15H2,1-4H3/t16-,17+,18-,20-,22+,23-,24?,25+,26+,27-,28+,29?,30?,31+,32+,33+/m0/s1 |
| |
CI-MS (NH3) m/z | 660 (M+H+NH3)+ (13), 642 (M+H+NH3 -18)+ (84), 625 (M+H- 18)+ (100), 607 (M+ H- 2x18)+ (23), 480 (M+C6H10O5)+ (91), 464 (65), 446 (56) | EI-MS m/z (relative intensity %) | | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
D2O | 01-Ha | | 01-He | | 02-Ha | 4.0 | 03-He | 4.08 | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.745 (s ) | 19-Me | 1.003 (s ) | 21-Me | 0.955 (d, ) | 22-H | 3.888 (d, ) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 3.460 (s ) | 27-Me | 1.180 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | 240 (?) |
| |
HPTLC | | TLC | | GLC | | HPLC | Retention time 7.97 min (column IBM C8, 15 cm long, 4.6 mm i.d., eluted isocratically with MeOH-aqueous NaH2PO4, 30 mM pH 5, 26:74 v/v, flow-rate 1 ml.min-1). |
| |
| |
|
Permanent link to this datasheet: 26-HYDROXYECDYSONE 22-GLUCOSIDE
|
|