|
|
Year of first isolation: |
2001 |
Formula: | C33H54O10 |
Molecular weight: | 610 |
Occurence in plants: |
Cucubalus baccifer [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H](C1)O[C@H]1C(C([C@@H](C(O1)CO)O)O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)(CCCC(C)(C)O)O)O)C)C »
| IUPAC Name | (3S,5R,9R,10R,13R,14S,17S)-17-((S)-2,6-dihydroxy-6-methylheptan-2-yl)-14-hydroxy-10,13-dimethyl-3-(((2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | WBZFDHVPSYROFE-VZSPAUEASA-N | InChI | InChI=1S/C33H54O10/c1-29(2,39)10-6-11-32(5,40)24-9-14-33(41)20-16-22(35)21-15-18(7-12-30(21,3)19(20)8-13-31(24,33)4)42-28-27(38)26(37)25(36)23(17-34)43-28/h16,18-19,21,23-28,34,36-41H,6-15,17H2,1-5H3/t18-,19-,21-,23?,24-,25+,26?,27?,28+,30+,31+,32-,33+/m0/s1 |
| |
EI-MS m/z (relative intensity %) | | FAB-MS (negative) | 609 [M-H] - (100), 447 [M-163] -- (12) | CI-MS (NH3) m/z | |
|
|
CD3OD | 01 | 30.19 | 02 | 27.93 | 03 | 71.48 | 04 | 31.49 | 05 | 53.44 | 06 | 206.30 | 07 | 121.91 | 08 | 168.97 | 09 | ? | 10 | 37.49 | 11 | 22.03 | 12 | 32.57 | 13 | 48.58 | 14 | 85.71 | 15 | 32.57 | 16 | 20.08 | 17 | ? | 18 | 18.12 | 19 | 24.24 | 20 | 75.99 | 21 | 26.49 | 22 | 45.70 | 23 | 20.08 | 24 | 45.88 | 25 | 71.48 | 26 | 29.34 | 27 | 29.15 |
|
CD3OD | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-He | 3.85 (d) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.80 (d) | 09-H | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.94 (s) | 19-Me | 0.84 (s) | 21-Me | 1.24 (s) | 22-Ha | | 22-Hb | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.18 (s) | 27-Me | 1.18 (s) | sugar (H-1') | 4.35 (d) |
|
| |
M.P. | - °C ; | [α]D28 | + 49 ° (c 1.1 ; MeOH) | IR (KBr) ν max (cm-1) | 3348 (OH), 1653 (unsaturated ketone) | UV (EtOH) λ max (log ε) | 244 (-) ; |
| |
| |
| |
|
Permanent link to this datasheet: 2,22-DIDEOXY-20-HYDROXYECDYSONE 3β-O-β-D-GLUCOPYRANOSIDE
|
|