|
|
|
|
Year of first isolation: |
1986 |
| Formula: | C45H76O7 |
| Molecular weight: | 728 |
| Occurence in plants: |
|
|
| Occurence in animals: |
Boophilus microplus [Ixodidae] » ![Wikipedia: Boophilus microplus [Ixodidae]](/images/wikipedia.png)
|
|
| |
| Canonical SMILES | CCCCCCCCC=CCCCCCCCC(=O)OOC(CCC(C)(C)O)C(C)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | CCCCCCCC/C=CCCCCCCCC(=O)OO[C@H](CCC(C)(C)O)C(C)[C@H]1CC[C@@]2([C@@]1(CCC3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)C)O » 
| | IUPAC Name | [(3R)-6-hydroxy-6-methyl-2-[(2S,3R,5R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-yl] (Z)-octadec-9-eneperoxoate | | CAS-RN | | | PubChem CID | 129776153 | InChiKey [ ChemIDPlus: search ] | YASLVSLCNXHDRF-HOHYFSRCSA-N | | InChI | InChI=1S/C45H76O8/c1-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-41(49)53-52-40(25-26-42(3,4)50)32(2)33-24-28-45(51)35-29-37(46)36-30-38(47)39(48)31-43(36,5)34(35)23-27-44(33,45)6/h14-15,29,32-34,36,38-40,47-48,50-51H,7-13,16-28,30-31H2,1-6H3/b15-14-/t32?,33-,34?,36+,38-,39+,40-,43-,44-,45-/m1/s1 |
| |
| CI-MS (NH3) m/z | | | EI-MS m/z (relative intensity %) | | | FAB-MS (matrix tetraethyleneglycol TEG) m/z (relative intensity %) | 923 (M+HTEG)+ (4), 729 (M+H)+ (8), 711 (37), 693 (4), 447 (11), 429 (100), 411 (640), 393 (8) | | HR-MS | |
|
|
| C5D5N | | 01 | | | 02 | | | 03 | | | 04 | | | 05 | | | 06 | | | 07 | | | 08 | | | 09 | | | 10 | | | 11 | | | 12 | | | 13 | | | 14 | | | 15 | | | 16 | | | 17 | | | 18 | | | 19 | | | 20 | | | 21 | | | 22 | | | 23 | | | 24 | | | 25 | | | 26 | | | 27 | |
|
| CDCl3 | | 01-Ha | | | 01-He | | | 02-Ha | 3.92 (m, w1/2=22) | | 03-He | 4.06 (m, w1/2=10) | | 04-Ha | | | 04-He | | | 05-H | | | 07-H | 5.857 (d, 2) | | 09-Ha | | | 11-Ha | | | 11-He | | | 12-Ha | | | 12-He | | | 15-Ha | | | 15-Hb | | | 16-Ha | | | 16-Hb | | | 17-H | | | 18-Me | 0.675 (s ) | | 19-Me | 0.993 (s ) | | 21-Me | 0.949 (d, 7) | | 22-H | 4.89 (m, w1/2=18) | | 23-Ha | | | 23-Hb | | | 24-Ha | | | 24-Hb | | | 26-Me | 1.232 (s ) | | 27-Me | 1.232 (s ) |
|
| |
| M.P. | | | [α]D20 | | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | |
| |
| HPTLC | | | TLC | Rf 0.15 (silica gel, CHCl3-MeOH 9:1); Rf 0.30 (C8 bonded silica gel, MeOH-H2O 19:1), other solvent systems also described for C18, C2 and CN bonded silica gel. | | GLC | (of fatty acid methyl ester) | | HPLC | 1- Retention time 24.5 min [Partisil 5 (Whatman), 250 mm x 4.6 mm i.d., solvent dichloroethane-iPrOH-H2O 125:24:1 v/v/v, flow-rate 1 ml.min-1]. 2-Retention time 21.5 min [ Ultrasphere-ODS (Beckman) 250 mm x 4.6 mm i.d., solvent linear gradient (30 min) of MeOH in H2O from 9:1 to 1:0 v/v, flow-rate 1 ml.min-1] |
| |
| |
| General | WIGGLESWORTH, K.P. et al. (1985) Arch. Insect Biochem. Physiol. 2, 39-54 |
 | | General | HOFFMANN, K.H. et al. (1985) Life Sci. 37, 185-192 |
 | | First isolation | CROSBY, T. et al. (1986) Biochem. J. 240, 131-138 |
 | | General | DINAN, L. et al. (1987) J. Chromatogr. 411, 379-392 |
 | | General | ROBINSON, P.D. et al. (1987) Physiol. Entomol. 12, 321-330 |
 | | General | DINAN, L. et al. (1988) J. Steroid Biochem. 31, 237-245 |
 | | General | DINAN, L. et al. (1988) J. Chromatogr. 436, 279-288 |
 |
| |
Permanent link to this datasheet: ECDYSONE 22-OLEATE
|
|