|
|
Year of first isolation: |
1994 |
Formula: | C27H45O9 P |
Molecular weight: | 544 |
Occurence in plants: |
|
Occurence in animals: |
Bombyx mori [Bombycidae] » ![Wikipedia: Bombyx mori [Bombycidae]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O[H])O[P](=O)([O-])[O-])C(=O)C=C3[C@@H]2CC[C@]4([C@]3(CC[C@@H]4[C@](C)(CCCC(C)(C)O[H])O[H])O[H])C)C » 
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17S)-17-((S)-2,6-dihydroxy-6-methylheptan-2-yl)-2,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,6,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-3-yl phosphate | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | OHVBYNSEXGQKQA-ADBNILCDSA-L | InChI | InChI=1S/C27H45O9P/c1-23(2,30)9-6-10-26(5,31)22-8-12-27(32)17-13-19(28)18-14-21(36-37(33,34)35)20(29)15-24(18,3)16(17)7-11-25(22,27)4/h13,16,18,20-22,29-32H,6-12,14-15H2,1-5H3,(H2,33,34,35)/p-2/t16-,18-,20-,21+,22-,24+,25+,26-,27+/m0/s1 |
| |
EI-MS m/z (relative intensity %) | | FAB-MS | 543 [M-H]-, 97 ([H2PO4]-, 79 [PO3]- | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | | 28 | | 29 | |
|
D2O | 01-Hb | | 02-Ha | 3.93 (m ) | 03-He | 4.44 (m ) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.97 (d ) | 09-Ha | 3.09 (m ) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.81 (s ) | 19-Me | 0.99 (s ) | 21-Me | 1.29 (s ) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.22 (s ) | 27-Me | 1.22 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | RP-HPLC, Column Wakosil 5C18, 10x250 mm eluted with a linear gradient (70 min) of MeOH in 20 mM phosphate buffer (pH 5.56) changing from 1:9 to 7:3 (v/v) with a flow-rate of 2 ml.min-1 at 40°C. Ret 58.2 min (20E22P 35.6; E22P 40.0; 2d20E22P 52.5; 2dE22P 56.4; 2,22d20E3P 63.2; Bombycosterol-3P 70.0 min); Column Wakosil 5C18, 4.6x250 mm eluted isocratically with 48% MeOH in 20 mM phosphate buffer (pH 5.56) at a flow-rate of 1 ml.min-1 at 40°C. Ret 39-40 min. |
| |
| |
|
Permanent link to this datasheet: 22-DEOXY-20-HYDROXYECDYSONE 3-PHOSPHATE
|
|