|
|
Year of first isolation: |
2021 |
Formula: | C27H44O6 |
Molecular weight: | 464 |
Occurence in plants: |
Cyanotis arachnoidea [Commelinaceae] » ![Wikipedia: Cyanotis arachnoidea [Commelinaceae]](/images/wikipedia.png)
|
Occurence in animals: |
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | CC(C)(CC[C@H]([C@@](C)([C@H]3CC[C@H]4C2=CC([C@H]1C[C@H]([C@H](C[C@]1(C)C2CC[C@]34C)O[H])O[H])=O)O[H])O[H])O[H] » 
| IUPAC Name | (2S,3R,5S,10R,13S,14R,17S)-2,3-dihydroxy-10,13-dimethyl-17-((2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl)-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | KBDUJCBPMFPAJU-FCOQXVNGSA-N | InChI | InChI=1S/C27H44O6/c1-24(2,32)10-9-23(31)27(5,33)22-7-6-16-15-12-19(28)18-13-20(29)21(30)14-26(18,4)17(15)8-11-25(16,22)3/h12,16-18,20-23,29-33H,6-11,13-14H2,1-5H3/t16-,17?,18+,20+,21-,22-,23+,25-,26+,27+/m0/s1 |
| |
HRESIMS (positive ion mode) m/z
| 465.32125 [M+H]+, calculated for C27H45O6 465.32107 |
|
|
DMSO-d6 | 01 | 42.4 | 02 | 68.5 | 03 | 70.8 | 04 | 24.1 | 05 | 53.4 | 06 | 198.8 | 07 | 122.4 | 08 | 163.5 | 09 | 50.1 | 10 | 37.5 | 11 | 21.4 | 12 | 38.7 | 13 | 44.8 | 14 | 54.9 | 15 | 22.1 | 16 | 21.3 | 17 | 54.5 | 18 | 14.0 | 19 | 15.4 | 20 | 75.6 | 21 | 20.9 | 22 | 76.2 | 23 | 26.1 | 24 | 41.4. | 25 | 68.9 | 26 | 29.0 | 27 | 30.0 |
|
DMSO-d6 | 01-Hɑ | 1.40 | 01-Hβ | 1.89 (dd, 14.1, 3.2) | 02-Hɑ | 3.75 | 03-Hɑ | 3.39 | 04-Hɑ | 1.68 | 04-Hβ | 1.52 | 05-Hɑ | 2.26 (dd, 12.0, 3.2) | 07-H | 5.52 (t, 2.2) | 09-H | 2.17 | 11-Hɑ | 1.74 | 11-Hβ | 1.56 | 12-Hɑ | 1.43 | 12-Hβ | 2.14 | 14-Hɑ | 2.04 (ddd, 12.0, 6.5, 1.5) | 15-Hɑ | 1.55 | 15-Hβ | 1.44 | 16-Hɑ | 1.53 | 16-Hβ | 1.88 | 17-Hɑ | 1.67 (t, 9.5) | 18-Me | 0.72 (s) | 19-Me | 0.88 (s) | 20-H | - | 21-Me | 1.09 (s) | 22-H | 3.10 | 23-H | 1.47, 1.10 | 24-H | 1.64, 1.24 | 25-H | - | 26-Me | 1.05 (s) | 27-Me | 1.07 (s) |
|
| |
M.P. | — °C ; | [α]D25 | +28.1° (c 0.096 ; MeOH) | IR (KBr) ν max (cm-1) | | UV (MeOH) λ max (log ε) | 245 nm (-) ; |
| |
| |
| |
|
Permanent link to this datasheet: 5α-14-DEOXY-20-HYDROXYECDYSONE
|
|