|
|
Year of first isolation: |
1987 |
Formula: | C33H54O11 |
Molecular weight: | 626 |
Occurence in plants: |
|
Occurence in animals: |
Parascaris equorum [Nematoda] » ![Wikipedia: Parascaris equorum [Nematoda]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)OC5C(C(C(C(O5)CO)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C[C@@H]([C@H]1CC[C@@]2([C@@]1(CC[C@H]3C2=CC(=O)[C@H]4[C@@]3(C[C@@H]([C@@H](C4)O)O)C)C)O)[C@@H](CCC(C)(C)OC5[C@@H]([C@H]([C@@H]([C@H](O5)CO)O)O)O)O » 
| IUPAC Name | (2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-17-[(2S,3R)-3-hydroxy-6-methyl-6-[(3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | 112172-82-4 | PubChem CID | 11988271 | InChiKey [ ChemIDPlus: search ] | YJBCWBWOULRKGL-OKFUDBSCSA-N | InChI | InChI=1S/C33H54O11/c1-16(21(35)8-9-30(2,3)44-29-28(41)27(40)26(39)25(15-34)43-29)17-7-11-33(42)19-12-22(36)20-13-23(37)24(38)14-31(20,4)18(19)6-10-32(17,33)5/h12,16-18,20-21,23-29,34-35,37-42H,6-11,13-15H2,1-5H3/t16-,17+,18-,20-,21+,23+,24-,25+,26+,27-,28+,29?,31+,32+,33+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | FAB-MS m/z | 625 (M-H)- | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
D2O | 01-Ha | | 01-He | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | | 19-Me | | 21-Me | | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | | 27-Me | | H-1' | 4.65 (d, 7.9) | H-2' | 3.21 (dd, 7.9, 9.4) | H-3' | 3.48 (dd, 9.4, 9.0) | H-4' | 3.34 (dd, 9.0. 9.8) | H-5' | 3.46 (m ) | H-6" | 3.66 (dd, 6.4, 12.3) | H-6' | 3.90 (dd, 2.1, 12.3) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | 1- Retention time 10.5 min [Radial-Pak C18 100 mm x 8 mm i.d., linear gradient (30 min) of MeOH-H2O from 1:1 to 1:0 v/v , flow-rate 1 ml.min-1] (20E : 9 min; E : 15 min); 2-Retention time 14.5 min [Radial-Pak C18 100 mm x 8 mm i.d., concave gradient (30 min) of MeOH-H2O 9:11 to 1:0, flow-rate 1 ml.min-1] (20E : 12.5 min; E : 25 min); 3-Retention time 13.5 min [Radial-Pak NH2 100 mm x 8 mm i.d., solvent dichloroethane-MeOH 4:1 v/v, flow-rate 1 ml.min-1] (20E and E : 5-6 min). |
| |
| |
|
Permanent link to this datasheet: ECDYSONE 25-O-β-D-GLUCOPYRANOSIDE
|
|