|
|
|
|
Year of first isolation: |
2000 |
| Formula: | C35H56O14 |
| Molecular weight: | 700 |
| Occurence in plants: |
Silene brahuica [Caryophyllaceae] »  ![Wikipedia: Silene brahuica [Caryophyllaceae]](/images/wikipedia.png)
|
| Occurence in animals: |
|
|
|
| |
| Canonical SMILES | CC(=O)OC(C)(C)CCC(C(C)(C1CCC2(C1(CCC3C2=CC(=O)C4C3(C(C(C(C4)O)O)O)C)C)O)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | [C@@H]1([C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)OC(=O)C)O[C@@H]1C(C([C@@H](C(O1)CO)O)O)O)O)O)C)C)O » 
| | IUPAC Name | [(5R,6R)-6-hydroxy-2-methyl-6-[(1S,2R,3R,5R,9R,10R,13R,14S,17S)-1,2,3,14-tetrahydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]-5-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl] acetate | | CAS-RN | | | PubChem CID | 10699909 | InChiKey
[ ChemIDPlus: search ] | NFANXDIFZWNPKW-GFUCUAQMSA-N | | InChI | InChI=1S/C35H56O14/c1-16(37)49-31(2,3)10-9-24(48-30-28(43)27(42)26(41)22(15-36)47-30)34(6,45)23-8-12-35(46)18-13-20(38)19-14-21(39)25(40)29(44)33(19,5)17(18)7-11-32(23,35)4/h13,17,19,21-30,36,39-46H,7-12,14-15H2,1-6H3/t17-,19-,21+,22+,23-,24+,25+,26-,27-,28+,29+,30+,32+,33+,34+,35+/m0/s1 |
| |
| CI-MS (NH3) m/z | 700 (M+), 682 (M+ - 18), 644 (M+ - 2x18), 640 (M+ - CH3COOH), 623, 605, 587, 569, 479, 461, 443, 180 (hexose) | | EI-MS m/z (relative intensity %) | ? | | HR-MS | 700.3893 (C35H58O13N) (calc. 700.3907). |
|
|
| D2O | | 01 | 75.6 | | 02 | 68.2 | | 03 | 70.0 | | 04 | 32.7 | | 05 | 46.5 | | 06 | -- | | 07 | 122.1 | | 08 | -- | | 09 | 35.4 | | 10 | 43.2 | | 11 | 21.3 | | 12 | 31.9 | | 13 | 48.4 | | 14 | 86.0 | | 15 | 31.5 | | 16 | 21.2 | | 17 | 50.1 | | 18 | 18.2 | | 19 | 20.0 | | 20 | 80.6 | | 21 | 21.8 | | 22 | 90.6 | | 23 | 26.4 | | 24 | 38.5 | | 25 | 85.9 | | 26 | 26.5 | | 27 | 26.7 | | AcO | 23.1, 174.9 | | gal-1' | 102.9 | | gal-2' | 70.9* | | gal-3' | 70.1* | | gal-4' | 70.3 | | gal-5' | 72.2 | | gal-6' | 61.8 |
|
| D2O | | 01-He | 3.93 (br, s) | | 02-Ha | 4.05 (br, t, 3.1) | | 03-He | 4.15 (br s, w1/2 = 12) | | 04-Ha | 1.79 | | 04-He | 1.82 | | 05-H | 2.62 (br, dd, 11, 6) | | 07-H | 5.99 (br, s, w1/2 = 6) | | 09-H | 3.05 (m, w1/2 = 23) | | 11-Ha | 1.75 | | 11-He | 1.80 | | 12-Ha | 1.95 | | 12-He | 1.75 | | 15-Ha | 1.67 | | 15-Hb | 2.06 | | 16-Ha | 1.90 | | 16-Hb | 1.75 | | 17-H | 2.29 (t, 8.7) | | 18-Me | 0.87 (s) | | 19-Me | 1.09 (s) | | 21-Me | 1.30 (s) | | 22-H | 3.42 (d, 9.5) | | 23-Ha | 1.47 | | 23-Hb | 1.59 | | 24-Ha | 1.95 | | 24-Hb | 2.06 | | 26-Me | 1.42 (s)* | | 27-Me | 1.47 (s)* | | AcO | 2.04 (s) | | H-1' | 5.10 (d, 3.4) | | H-2' | 3.91 (dd, 10.3, 3.4) | | H-3' | 3.94 ' | | H-4' | 4.04 (dd, 3, 1.2) | | H-5' | 4.11 (dt, 6.5, 1.2) | | H-6" | 3.76 (dd, 11.7, 6.7) | | H-6' | 3.74 (dd, 11.7, 5.8) |
|
| |
| M.P. | 210-212 °C ; | | [α]D20 | | | IR (KBr) ν max (cm-1) | 3398 (OH), 1655 (7-ene-6-one), 1707 | | UV (EtOH) λ max (log ε) | 242 ( ) ; |
| |
| |
| |
| |
Permanent link to this datasheet: SILENEOSIDE H
|
|
