|
|
|
|
Year of first isolation: |
2022 |
| Formula: | C28H46O7 |
| Molecular weight: | 494 |
| Occurence in plants: |
Aspergillus puniceus [Fungi] »  ![Wikipedia: Aspergillus puniceus [Fungi]](/images/wikipedia.png)
|
| Occurence in animals: |
|
|
|
| |
Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | C[C@@]12[C@@](C(C=C3C2CC[C@@]4(C)[C@@]3(O)CC[C@@]4([C@](C)([C@H](O)C[C@H](CO)C(C)C)O)[H])=O)([H])C[C@@H](O)[C@@H](O)C1 » 
| | IUPAC Name | (2S,3R,5R,10R,13R,14S,17S)-17-((2R,3R,5S)-2,3-dihydroxy-5-(hydroxymethyl)-6-methylheptan-2-yl)-2,3,14-trihydroxy-10,13-dimethyl-1,2,3,4,5,9,10,11,12,13,14,15,16,17-tetradecahydro-6H-cyclopenta[a]phenanthren-6-one | | CAS-RN | | | PubChem CID | | InChiKey
[ ChemIDPlus: search ] | HPVITCMZCGACHG-YVOHVHGBSA-N | | InChI | InChI=1S/C28H46O7/c1-15(2)16(14-29)10-24(33)27(5,34)23-7-9-28(35)18-11-20(30)19-12-21(31)22(32)13-25(19,3)17(18)6-8-26(23,28)4/h11,15-17,19,21-24,29,31-35H,6-10,12-14H2,1-5H3/t16-,17?,19+,21-,22+,23+,24-,25-,26-,27-,28-/m1/s1 |
| |
| HRESIMS (positive ion mode) m/z
| 495.3313 (M+H)+, calculated for C28H47O7 495.3316 |
|
|
| DMSO-d6 | | 01 | 36.6 | | 02 | 66.8 | | 03 | 66.6 | | 04 | 31.5 | | 05 | 50.1 | | 06 | 202.7 | | 07 | 120.4 | | 08 | 165.2 | | 09 | 33.2 | | 10 | 37.6 | | 11 | 20.1 | | 12 | 30.9 | | 13 | 46.8 | | 14 | 82.9 | | 15 | 30.3 | | 16 | 20.3 | | 17 | 48.6 | | 18 | 17.1 | | 19 | 23.9 | | 20 | 75.8 | | 21 | 20.8 | | 22 | 74.7 | | 23 | 30.6 | | 24 | 43.7 | | 25 | 27.4 | | 26 | 18.7 | | 27 | 19.6 | | 28 | 62.6 |
|
| DMSO-d6 | | 01-Ha | 1.26 (t, 12.6) | | 01-Hb | 1.58 | | 02-Ha | 3.61 (dt, 11.7, 3.1) | | 03-He | 3.76 (br, s) | | 04-Ha | 1.46 (m) | | 04-Hb | 1.57 | | 05-H | 2.20 (dd, 13.1, 4.0) | | 07-H | 5.62 (d, 2.1) | | 09-H | 3.01 (t, 8.3) | | 11-Ha | 1.52 | | 11-Hb | 1.65 (m) | | 12-Ha | 1.73 (m) | | 12-Hb | 2.02 (td, 12.8, 4.5) | | 15-Ha | 1.49 | | 15-Hb | 1.77 (m) | | 16-Ha | 1.56 | | 16-Hb | 1.89 (dd, 20.4, 10.6) | | 17-H | 2.28 (t, 8.9) | | 18-Me | 0.76 (s) | | 19-Me | 0.83 (s) | | 21-Me | 1.06 (s) | | 22-H | 3.24 (d, 10.0) | | 23-Ha | 1.10 (m) | | 23-Hb | 1.36 (dd, 13.4, 6.7) | | 24-H | 1.48 | | 25-H | 1.81 (m) | | 26-Me | 0.81 (d, 7.0) | | 27-Me | 0.85 (d, 7.0) | | 28-CH2OH | 3.31 (dd, 10.6, 7.2) 3.40 (dd, 10.4, 5.6) | | [02-OH] | 4.44 | | [03-OH] | 4.35 | | [14-OH] | 4.65 (s) | | [22-OH] | 4..51 | | [28-OH] | 4.47 |
|
| |
| M.P. | 239-241 °C ; | | [α]D25 | +54° (c 0.1 ; MeOH) | | IR (film) ν max (cm-1) | 3316, 2943, 2831, 1655, 1448, 1415, 1111, 1022, 665 | | UV (MeOH) λ max (log ε) | 242 nm (3.94) |
| |
| |
| |
| |
Permanent link to this datasheet: PUNICESTERONE F
|
|
