|
|
|
|
Year of first isolation: |
2009 |
| Formula: | C23H32O6 |
| Molecular weight: | 404 |
| Occurence in plants: |
Cyanotis longifolia [Commelinaceae] »  ![Wikipedia: Cyanotis longifolia [Commelinaceae]](/images/wikipedia.png)
|
| Occurence in animals: |
|
|
|
| |
| Canonical SMILES | CC(=O)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)OC(=O)C)C)C)O | Isomeric SMILES
[ PubChem: search | XML ]
[ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1OC(=O)C)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2C(=O)C)O)C)C » 
| | IUPAC Name | [(2S,3R,5R,9R,10R,13R,14S,17S)-17-acetyl-3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] acetate | | CAS-RN | | | PubChem CID | 15168048 | InChiKey
[ ChemIDPlus: search ] | GHVFPBQIXUAGPE-JKCRNPTCSA-N | | InChI | InChI=1S/C23H32O6/c1-12(24)14-6-8-23(28)16-9-18(26)17-10-19(27)20(29-13(2)25)11-21(17,3)15(16)5-7-22(14,23)4/h9,14-15,17,19-20,27-28H,5-8,10-11H2,1-4H3/t14-,15+,17+,19-,20+,21-,22-,23-/m1/s1 |
| |
| HR-MS | | | EI-MS m/z (relative intensity %) | | | CI-MS (NH3) m/z | 422 [M+NH4]+, 405 [MH]+, 344 [M-CH3COOH]+ |
|
|
| D2O | | 01 | 35.1 | | 02 | 74.1 | | 03 | 67.6 | | 04 | 33.6 | | 05 | 52.8 | | 06 | n.d. | | 07 | 123.9 | | 08 | n.d. | | 09 | 36.1 | | 10 | 40.0 | | 11 | 22.6 | | 12 | 31.9 | | 13 | 50.2 | | 14 | 86.9 | | 15 | 33.2 | | 16 | 23.2 | | 17 | 61.7 | | 18 | 19.0 | | 19 | 25.4 | | 20 | 221.4 | | 21 | 33.7 | | Ac [CH3] | 23.2 | | Ac [CO] | 175.7 |
|
| D2O | | 01-Ha | 1.56 (t, 13.1) | | 01-He | 1.99 | | 02-Ha | 5.10 (m, w1/2 = 22) | | 03-He | 4.24 (m, w1/2 = 8) | | 04-Ha | 1.80 | | 04-He | 1.84 | | 05-H | 2.44 (dd, 13.8, 4.4) | | 07-H | 6.02 (d, 2.2) | | 09-H | 3.22 (m, w1/2 = 22) | | 11-Ha | 1.73* | | 11-He | 1.96* | | 12-Ha | 1.92* | | 12-He | 2.20* | | 15-Ha | 2.12* | | 15-Hb | 1.76* | | 16-Ha | 1.91* | | 16-Hb | 2.22* | | 17-H | 3.34 (t, 8.5) | | 18-Me | 0.64 (s) | | 19-Me | 1.03 (s) | | 21-Me | 2.26 (s) | | CH3CO | 2.13 (s) |
|
| |
| M.P. | °C ; | | [α]D20 | ° (c ; MeOH) | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | () ; |
| |
| RP-HPLC | column YMC C18, 250 mm x 20.2 mm i.d, solvent MeOH/H2O 1:1, flow-rate 10 ml/min, Ret 30.6 min (20E : 12.4 min) | | HPLC | | | NP-HPLC | column Zorbax-SIL 250 mm x 4.6 mm i.d., solvent cyclohexane-isopropanol-water, flow-rate 1 mL/min, Ret 7.1 min (20E : 15.8 min) | | TLC | |
| |
| |
| |
Permanent link to this datasheet: POSTSTERONE 2-ACETATE
|
|
