|
|
Year of first isolation: |
1995 |
Formula: | C27H45O9P |
Molecular weight: | 544 |
Occurence in plants: |
|
Occurence in animals: |
Bombyx mori [Bombycidae] »
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC(C(C4)O)OP(=O)(O)O)C)C1(CCC2C(C)(CCCC(C)(C)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@@H]([C@H]1OP(=O)([O-])[O-])O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)(CCCC(C)(C)O)O)O)C)C »
| IUPAC Name | [(2S,3S,5R,9R,10R,13R,14S,17S)-17-[(2S)-2,6-dihydroxy-6-methylheptan-2-yl]-3,14-dihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-2-yl] dihydrogen phosphate | CAS-RN | | PubChem CID | 101915845 | InChiKey [ ChemIDPlus: search ] | GQXLTWAYLDYLHA-FTUASRNISA-N | InChI | InChI=1S/C27H45O9P/c1-23(2,30)9-6-10-26(5,31)22-8-12-27(32)17-13-19(28)18-14-20(29)21(36-37(33,34)35)15-24(18,3)16(17)7-11-25(22,27)4/h13,16,18,20-22,29-32H,6-12,14-15H2,1-5H3,(H2,33,34,35)/t16-,18-,20-,21-,22-,24+,25+,26-,27+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | FAB-MS m/z | 565 (M-H+Na)-, 543 (M-H)-, 97 (H2PO4)-, 79 (PO3)- | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CD3OD | 01-Ha | | 01-Hb | | 02-Ha | 4.24 (m ) | 03-Ha | 3.56 (m ) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.81 (br, s ) | 09-Ha | 3.21 (m ) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.85 (s ) | 19-Me | 0.95 (s ) | 21-Me | 1.27 (s ) | 22-Ha | | 22-Hb | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.19 (s ) | 27-Me | 1.19 (s ) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | HPLC | RP-HPLC, column Wakosil 5C18, 25 cm long, 10 mm i.d., linear gradient (70 min) of MeOH in 20 mM phosphate buffer (pH 5.56), changing from 1:9 to 7:3, 2 ml.min-1, Ret 58.5 min (numerous other references are run in this system); Anion-exchange chromatography column Chemcosorb 7 SAX, 25 cm long, 4.6 mm i.d, isocratic 0.1 M ammonium acetate, 2 ml.min-1, Ret 10 min. |
| |
| |
|
Permanent link to this datasheet: 3-EPI-22-DEOXY-20-HYDROXYECDYSONE 2-PHOSPHATE
|
|