|
|
Year of first isolation: |
1983 |
Formula: | C27H42O8 |
Molecular weight: | 494 |
Occurence in plants: |
|
Occurence in animals: |
Schistocerca gregaria [Orthoptera] » Spodoptera littoralis [Lepidoptera] » Pieris brassicae [Lepidoptera] »
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C(=O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C(=O)[O-])(C)O)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C(=O)[O-])(C)O)O)O)C)C » C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C(=O)[O-])(C)O)O)O)C)C »
| IUPAC Name | (5R,6S)-2,5-dihydroxy-2-methyl-6-[(2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptanoic acid | CAS-RN | 86583-57-5 | PubChem CID | 101600149 | InChiKey [ ChemIDPlus: search ] | SIDKGOYPRPHZJH-YAVKZWDVSA-N | InChI | InChI=1S/C27H42O8/c1-14(19(28)7-9-26(4,34)23(32)33)15-6-10-27(35)17-11-20(29)18-12-21(30)22(31)13-24(18,2)16(17)5-8-25(15,27)3/h11,14-16,18-19,21-22,28,30-31,34-35H,5-10,12-13H2,1-4H3,(H,32,33)/t14-,15+,16-,18-,19+,21+,22-,24+,25+,26?,27+/m0/s1 |
| |
CI-MS (NH3) m/z | (of methyl ester) | EI-MS m/z (relative intensity %) | | FAB-MS m/z | 493 (M-H)- | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CD3OD | 01-Ha | | 01-He | | 02-Ha | 3.85 (m, w1/2=22) | 03-He | 3.95 (m, w1/2=9) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.80 | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.71 (s ) | 19-Me | 0.96 (s ) | 21-Me | 0.91 (d, 10) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.33 (s ) | 27-Me | -- |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | RP-HPLC (ion-suppression mode) : Retention volume 12 ml [Waters Resolve column 150 mm x 4.6 mm i.d., solvent MeOH-20 mM Na citrate, pH 6.5, 30:70, flow-rate 1 ml.min-1] |
| |
| |
|
Permanent link to this datasheet: ECDYSONOIC ACID
|
|