|
|
Year of first isolation: |
2018 |
Formula: | C29H44O8 |
Molecular weight: | 520 |
Occurence in plants: |
|
Occurence in animals: |
Antipathozoanthus hickmani [Parazoanthidae] »
|
|
| |
Canonical SMILES | CC12CCC3C(=CC(=O)C4C3(CC5(CC(=O)OC5C4)O)C)C1(CCC2C(C)(C(CCC(C)(C)O)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@@H]3[C@]1(CC(=O)O3)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O)C)C »
| IUPAC Name | (1R,2R,4S,8R,10R,14S,17S,18R)-4,14-dihydroxy-2,18-dimethyl-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-7-oxapentacyclo[11.7.0.02,10.04,8.014,18]icos-12-ene-6,11-dione | CAS-RN | | PubChem CID | 138453998 | InChiKey [ ChemIDPlus: search ] | KPRLZEATQBILFE-JITQUFICSA-N | InChI | InChI=1S/C29H44O8/c1-24(2,33)9-8-21(31)27(5,34)20-7-11-29(36)17-12-19(30)18-13-22-28(35,14-23(32)37-22)15-25(18,3)16(17)6-10-26(20,29)4/h12,16,18,20-22,31,33-36H,6-11,13-15H2,1-5H3/t16-,18-,20-,21+,22+,25+,26+,27+,28+,29+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | HRESI-MS m/z (positive ion mode) m/z | 521.3107 [M+H] + , calc. for C29H45O8 521.3109 (∆ -0.38 ppm) |
|
|
CD3OD | 01 | 41.9 | 02 | 74.0 | 03 | 82.0 | 04 | 25.1 | 05 | 52.1 | 06 | 205.3 | 07 | 121.6 | 08 | 169.3 | 09 | 35.7 | 10 | 37.0 | 11 | 21.4 | 12 | 32.5 | 13 | 48.8 | 14 | 85.1 | 15 | 31.9 | 16 | 21.5 | 17 | 50.5 | 18 | 18.1 | 19 | 24.1 | 20 | 77.9 | 21 | 21.0 | 22 | 78.4 | 23 | 27.3 | 24 | 42.4 | 25 | 71.3 | 26 | 28.9 | 27 | 29.7 |
01' | 176.1 |
02' | 47.1 |
|
CD3OD | 01-Ha | 2.11 (M) | 01-Hb | 1.09 (d, 15.0) | 02-H | | 03-He | 4.50 (br, s) | 04-Ha | 2.13 (m) | 04-Hb | 1.93 (m) | 05-H | 2.10 (m) | 07-H | 5.83 (d, 2.0) | 09-H | 3.80 (ddd, 11.5, 6.5, 2.0) | 11-Ha | 1.93 (m) | 11-Hb | 1.65 (m) | 12-Ha | 2.15 (m) | 12-Hb | 1.84 (m) | 15-Ha | 1.98 (m) | 15-Hb | 1.59 (t, 10.0) | 16-Ha | 1.98 (m) | 16-Hb | 1.73 (m) | 17-H | 2.39 (t, 8.6) | 18-Me | 0.89 (s) | 19-Me | 0.93 (s) | 21-Me | 1.19 (s) | 22-H | 3.33 (m) | 23-Ha | 1.66 (m) | 23-Hb | 1.28 (m) | 24-Ha | 1.80 (td, 12.5, 4.5) | 24-Hb | 1.43 (td, 12.5, 4.5) | 25-H | | 26-Me | 1.19 (s) | 27-Me | 1.20 (s) |
2'a | 2.71 (d, 17.0) |
2'b | 2.50 (d, 17.0) |
|
| |
M.P. | °C ; | [α]D20 | +30 ° (c 0.1; MeOH) | IR (KBr) ν max (cm-1) | | UV (DAD) λ max (log ε) | 248 () ; |
| |
| |
| |
|
Permanent link to this datasheet: ECDYSONELACTONE C
|
|