|
|
Year of first isolation: |
1986 |
Formula: | C29H46O8 |
Molecular weight: | 522 |
Occurence in plants: |
|
Occurence in animals: |
Pycnogonum litorale [pantopod] » ![Wikipedia: Pycnogonum litorale [pantopod]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)O)OC(=O)CO | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)OC(=O)CO)O)C)C » 
| IUPAC Name | [(2S)-6-hydroxy-6-methyl-2-[(2S,3R,5R,9R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-17-yl]heptan-3-yl] 2-hydroxyacetate | CAS-RN | | PubChem CID | 53782485 | InChiKey [ ChemIDPlus: search ] | DWGPILQUVCSXAN-PAAYHOKBSA-N | InChI | InChI=1S/C29H46O8/c1-16(24(37-25(34)15-30)8-9-26(2,3)35)17-7-11-29(36)19-12-21(31)20-13-22(32)23(33)14-27(20,4)18(19)6-10-28(17,29)5/h12,16-18,20,22-24,30,32-33,35-36H,6-11,13-15H2,1-5H3/t16-,17+,18-,20-,22+,23-,24?,27+,28+,29+/m0/s1 |
| |
CI-MS (NH3) m/z | 540 (MH + NH3)+, 523 (MH)+, 505, 487, 464, 447 (M-glycolic acid)+, 429, 411 | EI-MS m/z (relative intensity %) | | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
D2O | 01-Ha | | 01-Hb | | 02-Ha | 3.99 (m, w1/2=21) | 03-He | 4.06 (m, w1/2=8) | 04-Ha | | 04-He | | 05-H | | 07-H | 5.98 (d, 2.5) | 09-Ha | 3.10 (m, w1/2=22) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.72 (s ) | 19-Me | 1.00 (s ) | 21-Me | 0.98 (br d ) | 22-H | 4.99 (d, w1/2=14) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | 1.22 (s ) | 27-Me | 1.22 (s ) | OCOCH2O | 4.25 (s, 2H) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | NP-HPLC | Normal phase (Merck Lichrosorb Si 60), solvent CH2Cl2-iPrOH-H2O (125:30:2) Ret. 12.6 ml, (E : 16.4 ml). | RP-HPLC | Reverse phase (Merck Supersphere RP18, 15 cm long, 4 mm i.d.), eluted with acetonitrile-0.1% TFA (16:84 isocratic for 10 min, then linear gradient 16:84 to 40:60 in 25 min) Ret 24.6 min, (E : 18.7 min). |
| |
| |
|
Permanent link to this datasheet: ECDYSONE 22-GLYCOLATE
|
|