|
|
|
|
Year of first isolation: |
1982 |
| Formula: | C31H49O11P |
| Molecular weight: | 628 |
| Occurence in plants: |
|
|
| Occurence in animals: |
Locusta migratoria [Orthoptera] » ![Wikipedia: Locusta migratoria [Orthoptera]](/images/wikipedia.png)
|
|
| |
| Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)OC(=O)C)OC(=O)C)C)C)O)C(CCC(C)(C)O)OP(=O)(O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1OC(=O)C)OC(=O)C)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)OP(=O)([O-])[O-])O)C)C » 
| | IUPAC Name | [(2S,3R,5R,9R,10R,13R,14S,17R)-2-acetyloxy-14-hydroxy-17-[(2S)-6-hydroxy-6-methyl-3-phosphonooxyheptan-2-yl]-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | | CAS-RN | | | PubChem CID | 69757005 | InChiKey [ ChemIDPlus: search ] | FHOZWLZWAHQDND-USQXDWPUSA-N | | InChI | InChI=1S/C31H49O11P/c1-17(25(42-43(37,38)39)10-11-28(4,5)35)20-9-13-31(36)22-14-24(34)23-15-26(40-18(2)32)27(41-19(3)33)16-29(23,6)21(22)8-12-30(20,31)7/h14,17,20-21,23,25-27,35-36H,8-13,15-16H2,1-7H3,(H2,37,38,39)/t17-,20+,21-,23-,25?,26+,27-,29+,30+,31+/m0/s1 |
| |
| CI-MS (NH3) m/z | | | EI-MS m/z (direct inlet on gold support) | 548, 530 (M-H3PO4)+, 515 | | HR-MS | |
|
|
| C5D5N | | 01 | | | 02 | | | 03 | | | 04 | | | 05 | | | 06 | | | 07 | | | 08 | | | 09 | | | 10 | | | 11 | | | 12 | | | 13 | | | 14 | | | 15 | | | 16 | | | 17 | | | 18 | | | 19 | | | 20 | | | 21 | | | 22 | | | 23 | | | 24 | | | 25 | | | 26 | | | 27 | |
|
| CD3OD | | 01-Ha | | | 01-He | | | 02-Ha | | | 03-He | | | 04-Ha | | | 04-He | | | 05-H | | | 07-H | | | 09-Ha | | | 11-Ha | | | 11-He | | | 12-Ha | | | 12-He | | | 14-H | | | 15-Ha | | | 15-Hb | | | 16-Ha | | | 16-Hb | | | 17-H | | | 18-Me | 0.70 | | 19-Me | 0.95 | | 21-Me | 0.95 | | 22-H | | | 23-Ha | | | 23-Hb | | | 24-Ha | | | 24-Hb | | | 25-H | | | 26-Me | 1.20 | | 27-Me | 1.20 | | O-Ac | 1°95 (6H) |
|
| |
| M.P. | | | [α]D20 | | | IR (KBr) ν max (cm-1) | | | UV (EtOH) λ max (log ε) | |
| |
| HPTLC | | | TLC | | | GLC | | | HPLC | Retention time 17 min [column Lichroprep C18 10 ?m, 250 mm long, 4 mm i.d., eluted with a gradient 12% to 44% (in 32 min, gradient former Waters M660, curve 7) of acetonitrile in 20 mM tris-HCl, pH 7.5, flow-rate 1 ml.min-1] |
| |
| |
| First isolation | TSOUPRAS, G. et al. (1982) Thesis, Strasbourg, France |
 | | General | LAGUEUX, M. et al. (1984) In: Biosynthesis, Metabolism and Mode of Action of Invertebrate Hormones (eds., Hoffmann J.A., Porchet M.), Springer-Verlag, Berlin, pp. 168-180 |
 |
| |
Permanent link to this datasheet: ECDYSONE 2,3-DIACETATE 22-PHOSPHATE
|
|