|
|
Year of first isolation: |
1991 |
Formula: | C33H54O11 |
Molecular weight: | 626 |
Occurence in plants: |
|
Occurence in animals: |
formation by Baculovirus transferase in insects » 
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)C(CCC(C)(C)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)O[C@H]1C(C([C@@H](C(O1)CO)O)O)O)O)C)C » 
| IUPAC Name | (2S,3R,10R,13R,14S,17R)-2,3,14-trihydroxy-17-[(2S,3R)-6-hydroxy-6-methyl-3-[(3S,4R,5R,6S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 11296575 | InChiKey [ ChemIDPlus: search ] | XXCLVBBGHDLQES-WAUUTZGMSA-N | InChI | InChI=1S/C33H54O11/c1-16(24(8-9-30(2,3)41)43-29-28(40)27(39)26(38)25(15-34)44-29)17-7-11-33(42)19-12-21(35)20-13-22(36)23(37)14-31(20,4)18(19)6-10-32(17,33)5/h12,16-18,20,22-29,34,36-42H,6-11,13-15H2,1-5H3/t16-,17+,18?,20?,22+,23-,24+,25-,26-,27+,28-,29?,31+,32+,33+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | HR-MS | | FAB-MS (negative mode) m/z | 625 [M-H]- |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | | 28 | | 29 | |
|
D2O | 01-Ha | | 01-Hb | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | | 19-Me | | 21-Me | 0.880 (d, 6.7) | 22-H | 3.649 (m, br) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | | 27-Me | | glu-1 | 4.45 (d, 8) | glu-2 | 3.21 (dd, 8.1, 9.2) | glu-3 | 3.40 (dd, 9.1, 9.0) | glu-4 | 3.30 (dd, 9.2, 9.4) | glu-5 | 3.37 (complex) | glu-6a | 3.81 (dd, 2.2, 12.3) | glu-6b | 3.61 (dd, 6.0, 12.3) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | RP-HPLC | Retention time 29 min [mBondapac C18, 300 mm x 3.9 mm i.d., linear gradient (60 min) of MeOH-H2O from 1:9 to 1:0 v/v, flow-rate 1 ml.min-1] (E: 36 min) |
| |
| |
|
Permanent link to this datasheet: ECDYSONE 22-GLUCOSIDE
|
|