|
|
Year of first isolation: |
1982 |
Formula: | C37H56O12N5P |
Molecular weight: | 792 |
Occurence in plants: |
|
Occurence in animals: |
Locusta migratoria [Orthoptera] » ![Wikipedia: Locusta migratoria [Orthoptera]](/images/wikipedia.png)
|
|
| |
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C[C@]12[C@@]([H])(C[C@H]([C@H](C2)[O][H])[O][H])C(C=C3C1CC[C@]4([C@]3(CC[C@@]4([C@H](C)[C@@H](CCC([O][H])(C)C)[O][P]([O]C[C@H]5[O][C@H]([C@@H]([C@@H]5[O][H])[O][H])[N]6C=[N]C7=C6[N]=C[N]=C7[N]([H])[H])([O][H])=[O])[H])[O][H])C)=[O] » 
| IUPAC Name | ((2R,3S,4R,5R)-5-(6-amino-9H-purin-9-yl)-3,4-dihydroxytetrahydrofuran-2-yl)methyl ((2S,3R)-6-hydroxy-6-methyl-2-((2S,3R,5R,10R,13R,14S,17R)-2,3,14-trihydroxy-10,13-dimethyl-6-oxo-2,3,4,5,6,9,10,11,12,13,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl)heptan-3-yl) hydrogen phosphate | CAS-RN | 94036-01-8 | PubChem CID | | InChiKey [ ChemIDPlus: search ] | JPGNGCBJGFLVNO-HNJBQQIFSA-N | InChI | InChI=1S/C37H56N5O12P/c1-18(19-7-11-37(49)21-12-23(43)22-13-24(44)25(45)14-35(22,4)20(21)6-10-36(19,37)5)26(8-9-34(2,3)48)54-55(50,51)52-15-27-29(46)30(47)33(53-27)42-17-41-28-31(38)39-16-40-32(28)42/h12,16-20,22,24-27,29-30,33,44-49H,6-11,13-15H2,1-5H3,(H,50,51)(H2,38,39,40)/t18-,19+,20?,22-,24+,25-,26+,27+,29+,30+,33+,35+,36+,37+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | HR-MS | MS-Laser ionization m/z: 79 (PO3)-, 63 (PO2)- |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
D2O | 01-Ha | | 01-He | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 09-Ha | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.72 (s ) | 19-Me | 0.96 (s ) | 21-Me | 0.92 (d, 6.4) | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.20 (s ) | 27-Me | 1.20 (s ) | aromatic | 7.4 (2H) |
|
| |
M.P. | | [α]D20 | | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | Retention time 17 min [column Lichroprep C18 10 ?m, 250 mm long, 4 mm i.d., eluted with a gradient 12% to 44% (in 32 min, gradient former Waters M660, curve 7) of acetonitrile in 20 mM tris-HCl, pH 7.5, flow-rate 1 ml.min-1] |
| |
| |
First isolation | TSOUPRAS, G. et al. (1982) Thesis, Strasbourg, France |
 | General | LAGUEUX, M. et al. (1984) In: Biosynthesis, Metabolism and Mode of Action of Invertebrate Hormones (eds., Hoffmann J.A., Porchet M.), Springer-Verlag, Berlin, pp. 168-180 |
 |
|
Permanent link to this datasheet: ECDYSONE 22-ADENOSINE-MONOPHOSPHATE
|
|