|
|
Year of first isolation: |
2009 |
Formula: | C30H48O6 |
Molecular weight: | 504 |
Occurence in plants: |
Silene viridiflora [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC1(OC(C(O1)(C)C2CCC3(C2(CCC4C3=CC(=O)C5C4(CCC(C5)O)C)C)O)CCC(C)(C)O)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@H](C[C@H](C1)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@]1(C)[C@@H](CCC(C)(C)O)OC(O1)(C)C)O)C)C »
| IUPAC Name | (3S,5S,9R,10R,13R,14S,17S)-3,14-dihydroxy-17-[(4R,5R)-5-(3-hydroxy-3-methylbutyl)-2,2,4-trimethyl-1,3-dioxolan-4-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 70691138 | InChiKey [ ChemIDPlus: search ] | GIDOJSDRNURPMM-QGDYWCDTSA-N | InChI | InChI=1S/C30H48O6/c1-25(2,33)12-11-24-29(7,36-26(3,4)35-24)23-10-15-30(34)20-17-22(32)21-16-18(31)8-13-27(21,5)19(20)9-14-28(23,30)6/h17-19,21,23-24,31,33-34H,8-16H2,1-7H3/t18-,19-,21+,23-,24+,27+,28+,29+,30+/m0/s1 |
| |
HR-ESI-MS | 527.3336, calculated 527.3349 for C30H48O6Na+ | ESI-MS m/z (relative intensity %) | 1031 (9) [2M+Na]+, 544 (9) [M+H+K]+, 528 (14) [M+H+Na]+, 527 (41) [M+Na]+, 504 (10) [M]+, 487 (39) [M+H-H2O]+, 429 (100) [M+H-H2O-Me2CO]+, 413 (23), 391 (60), 333 (21) |
|
|
CD3OD | 01 | 38.0 | 02 | 31.5 | 03 | 71.31 | 04 | 31.0 | 05 | 54.7 | 06 | 203.3 | 07 | 123.6 | 08 | 166.5 | 09 | 47.6 | 10 | 39.7 | 11 | 21.7 | 12 | 32.4 | 13 | 48.4 | 14 | 85.3 | 15 | 31.9 | 16 | 22.5 | 17 | 50.7 | 18 | 17.8 | 19 | 13.4 | 20 | 86.0 | 21 | 22.7 | 22 | 83.5 | 23 | 24.9 | 24 | 42.4 | 25 | 71.27 | 26 | 29.1 | 27 | 23.6 | Me2C | 108.2, 27.3, 29.5 |
|
CD3OD | 01-Ha | 1.38-1.43 (m) | 01-He | 1.87 (d, ~12.5) | 02-Ha | 1.76-1.82 (m) | 02-He | 1.37-1.41 (m) | 03-Ha | 3.55 (tt, 11.0, 4.4) | 04-Ha | 1.365 (q, 12.0) | 04-He | 2.07-2.14 (m) | 05-H | 2.355 (dd, 12.2, 3.6) | 07-H | 5.83 (d, 2.8) | 09-H | 2.75 (ddd, 11.7, 7.2, 2.7) | 11-Ha | 1.60-1.66 (m) | 11-He | 1.75-1.82 (m) | 12-Ha | 2.07-2.16 (m) | 12-He | 1.78-1.86 (m) | 15-Ha | 1.615 (t, ~13.0) | 15-Hb | 1.93-1.98 (m) | 16-Ha | 1.83-1.89(m) | 16-Hb | 1.99-2.07 (m) | 17-H | 2.30 (dd, 9.1, 8.6) | 18-Me | 0.826 (s) | 19-Me | 0.854 (s) | 21-Me | 1.175 (s) | 22-H | 3.66-3.71 (m) | 23-Ha | 1.47-1.58 (m) | 23-Hb | 1.47-1.58 (m) | 24-Ha | 1.44-1.53 (m) | 24-Hb | 1.69-1.78 (m) | 26-Me | 1.196 (s) | 27-Me | 1.205 (s) | Me2C | 1.32 (s); 1.39 (s) |
|
| |
M.P. | °C ; | [α]D25 | +57 ° (c 0.05; MeOH) | IR (KBr) ν max (cm-1) | | UV (MeOH) λ max (log ε) | 238 (3.4) |
| |
| |
| |
|
Permanent link to this datasheet: 5α-2-DEOXY-20-HYDROXYECDYSONE 20,22-ACETONIDE
|
|