|
|
Year of first isolation: |
1997 |
Formula: | C29H46O7 |
Molecular weight: | 506 |
Occurence in plants: |
Silene otites [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(=O)OC1CCC2(C3CCC4(C(CCC4(C3=CC(=O)C2C1)O)C(C)(C(CCC(C)(C)O)O)O)C)C | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@H](C[C@H](C1)OC(=O)C)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@](C)([C@@H](CCC(C)(C)O)O)O)O)C)C »
| IUPAC Name | [(3S,5S,9R,10R,13R,14S,17S)-14-hydroxy-10,13-dimethyl-6-oxo-17-[(2R,3R)-2,3,6-trihydroxy-6-methylheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | CAS-RN | | PubChem CID | 16755625 | InChiKey [ ChemIDPlus: search ] | JYZWBQULDMOHQE-ZPQFWNFQSA-N | InChI | InChI=1S/C29H46O7/c1-17(30)36-18-7-12-26(4)19-8-13-27(5)23(28(6,34)24(32)10-11-25(2,3)33)9-14-29(27,35)20(19)16-22(31)21(26)15-18/h16,18-19,21,23-24,32-35H,7-15H2,1-6H3/t18-,19-,21+,23-,24+,26+,27+,28+,29+/m0/s1 |
| |
FAB-MS (negative mode) m/z | 505.3162, C29H45O7 requires 505.3165 | CI-MS (NH3) m/z | 524 (M+H+NH3)+, 507 (M+H)+, 489, 471, 453, 429, 406, ? | EI-MS m/z (relative intensity %) | 389 (M-C6H13O2) (6), 371 (29), 329 (16), 327 (27), 311 (70), 293 (12), 285 (9), 267 (30), 161 (22), 143 (43), 125 (21), 117 (27), 107 (40), 99 (84), 91 (100) |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-He | 4.78 (br m) | 04-Ha | | 04-He | | 05-H | | 07-H | 6.16 (d, 2.7) | 09-H | 2.99 (m) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | 3.00 (m) | 18-Me | 1.19 (s) | 19-Me | 0.86 (s) | 21-Me | 1.58 (s) | 22-H | 3.90 (d, 9.4) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.38 (s) | 27-Me | 1.38 (s) |
|
| |
M.P. | 257-259 °C | [α]D20 | | IR (KBr) ν max (cm-1) | 3420, 2968, 1735, 1712, 1656, 1464, 1381, 1237, 1135, 1029, | UV (EtOH) λ max (log ε) | |
| |
HPTLC | | TLC | | GLC | | HPLC | NP-HPLC, Zorbax-SIL 25 cm x 4.6 mm i.d., solvent cyclohexane-iPrOH-H2O 100:30: 1.5 v/v/v, flow-rate 1 ml.min-1, Ret. 10.2 min (2d20E 18.8 min); Zorbax-SIL 25 cm x 9.4 mm i.d., solvent CH2Cl2-PrOH-H2O 125:15:1 v/v/v, flow-rate 4 ml.min-1, Ret. 14.2 min. |
| |
| |
|
Permanent link to this datasheet: (5α)-2-DEOXY-20-HYDROXYECDYSONE 3-ACETATE
|
|