|
|
Year of first isolation: |
2007 |
Formula: | C33H54O10 |
Molecular weight: | 610 |
Occurence in plants: |
Microsorum scolopendria [Polypodiaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C)CCC(C(C)C1CCC2(C1(CCC3C2=CC(=O)C4C3(CC(C(C4)O)O)C)C)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H]([C@H]1O)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)C)O[C@H]1OC([C@H](C(C1O)O)O)CO)O)C)C »
| IUPAC Name | (2S,3R,5R,10R,13R,14S)-2,3,14-trihydroxy-10,13-dimethyl-17-[(2S,3R)-6-methyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 44231706 | InChiKey [ ChemIDPlus: search ] | WEFZPAHDQUWFLV-POSSUGAPSA-N | InChI | InChI=1S/C33H54O10/c1-16(2)6-7-25(42-30-29(40)28(39)27(38)26(15-34)43-30)17(3)18-9-11-33(41)20-12-22(35)21-13-23(36)24(37)14-31(21,4)19(20)8-10-32(18,33)5/h12,16-19,21,23-30,34,36-41H,6-11,13-15H2,1-5H3/t17-,18?,19?,21-,23+,24-,25+,26+,27+,28-,29+,30+,31+,32+,33+/m0/s1 |
| |
HR-MS | | EI-MS m/z (relative intensity %) | 610 [M+NH4-H2O]+, 593 [M+H-H2O]+, 448 [M+NH4-sugar]+, 431 [M+H-sugar]+, 415 [M+H-sugar-H2O]+, 350, 332, 226, 164, 136. | CI-MS (NH3) m/z | |
|
|
D2O | 01 | 37.7 | 02 | 69.9 | 03 | 69.9 | 04 | 33.9 | 05 | 53.2 | 06 | n.d. | 07 | 123.5 | 08 | n.d. | 09 | 36.5 | 10 | 41.8 | 11 | 22.8 | 12 | 33.0 | 13 | 49.4 | 14 | 86.8 | 15 | 32.8 | 16 | n.d. | 17 | 50.1 | 18 | 17.8 | 19 | 25.8 | 20 | 42.9 | 21 | 15.5 | 22 | 89.9 | 23 | n.d. | 24 | 38.0 | 25 | 30.6 | 26 | 24.6 | 27 | 25.4 | [Glu] 01' | 107.4 | [Glu] 02' | 76.6 | [Glu] 03' | 78.9 | [Glu] 04' | 72.7 | [Glu] 05' | 78.6 | [Glu] 06' | 63.3 |
|
D2O | 01-Ha | 1.38 | 01-He | 1.88 | 02-Ha | 3.99 (w1/2 = 22) | 03-He | 4.07 (w1/2 = 8) | 04-Ha | 1.75 | 04-He | 1.75 | 05-H | 2.34 (t) | 07-H | 5.98 (d, 2.5) | 09-H | 3.10 (w1/2 = 22) | 11-Ha | 1.70 | 11-He | 1.84 | 12-Ha | 1.87 | 12-He | 1.87 | 15-Ha | 1.62 | 15-Hb | 2.05 | 16-Ha | 1.95 | 16-Hb | 1.87 | 17-H | 1.87 | 18-Me | 0.737 (s) | 19-Me | 1.000 (s) | 20-H | 2.14 | 21-Me | 0.936 (d, 6.6) | 22-H | 3.73 (db, 10) | 23-Ha | 1.28 | 23-Hb | 1.46 | 24-Ha | 1.49 | 24-Hb | 1.49 | 25-H | 1.56 | 26-Me | 0.887 (d, 6.6) | 27-Me | 0.899 (d, 6.6) | [Glu] 1-H' | 4.52 (d, 8.2) | [Glu] 2-H' | 3.28 (dd, 9.8) | [Glu] 3-H' | 3.47 (t, 9.0) | [Glu] 4-H' | 3.37 (t, 9.4) | [Glu] 5-H' | 3.43 (m) | [Glu] 6-H' | 3.69 (dd, 12.3, 6.2) | [Glu] 6-H'' | 3.87 (dd, 12.3, 1.8) |
|
| |
M.P. | - °C ; | [α]D20 | +- ° (c ; MeOH) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | () ; |
| |
HPLC | NP-HPLC Kromasil column (250 x 4.6 mm i.d.) solvent dichloro-methane-isopropanol-water (125:30:1.5), flow-rate 1 ml/min, ret. 16.7 min (20E: 27.8 min);
RP-HPLC Spherisorb 5ODS2 column (250 x 4.6 mm i.d.) solvent methanol-water (45:55), flow-rate 0.7 ml/min, ret 29.8 min (20E: 10.9 min) | TLC | |
| |
| |
|
Permanent link to this datasheet: 25-DEOXYECDYSONE 22-O-β-D-GLUCOPYRANOSIDE
|
|