|
|
Year of first isolation: |
2001 |
Formula: | C33H54O10 |
Molecular weight: | 610 |
Occurence in plants: |
Silene pseudotites [Caryophyllaceae] » Silene praemixta [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)O)C)C)O)C(CCC(C)(C)O)OC5C(C(C(C(O5)CO)O)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H](C1)O)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)O[C@H]1OC([C@H](C(C1O)O)O)CO)O)C)C »
| IUPAC Name | (3S,5R,9R,10R,13R,14S,17R)-3,14-dihydroxy-17-[(2S,3R)-6-hydroxy-6-methyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyheptan-2-yl]-10,13-dimethyl-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-6-one | CAS-RN | | PubChem CID | 11319465 | InChiKey [ ChemIDPlus: search ] | HFTFNYVQJAPPKR-WQYANTGASA-N | InChI | InChI=1S/C33H54O10/c1-17(24(9-10-30(2,3)40)42-29-28(39)27(38)26(37)25(16-34)43-29)19-8-13-33(41)21-15-23(36)22-14-18(35)6-11-31(22,4)20(21)7-12-32(19,33)5/h15,17-20,22,24-29,34-35,37-41H,6-14,16H2,1-5H3/t17-,18-,19+,20-,22-,24+,25+,26+,27-,28+,29+,31+,32+,33+/m0/s1 |
| |
HR-MS | | EI-MS m/z (relative intensity %) | | CI-MS (NH3) m/z | 628 (M+H+NH3)+, 611 (M+H)+, 610 (M)+, 593 (M+H-H2O)+ |
|
|
D2O | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
C5D5N | 01 | | 02 | 29.09 | 03 | 64.04 | 04 | 33.10 | 05 | | 06 | 206.53 | 07 | 121.35 | 08 | 166.06 | 09 | | 10 | 36.98 | 11 | 21.41 | 12 | 31.86 | 13 | 48.33 | 14 | 84.11 | 15 | 31.60 | 16 | 24.53 | 17 | 48.33 | 18 | 15.92 | 19 | 24.34 | 20 | 41.07 | 21 | 14.31 | 22 | 85.39 | 23 | 26.66 | 24 | 41.34 | 25 | 69.72 | 26 | 29.41 | 27 | 30.61 | glu-1 | 106.92 | glu-2 | 75.71 | glu-3 | 78.79 | glu-4 | 72.09 | glu-5 | 78.06 | glu-6 | 63.19 |
|
D2O | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-He | 4.10 (s, br, w1/2 = 23) | 04-Ha | | 04-He | | 05-H | 2.41 (dd, br, 12.3, 3.2) | 07-H | 5.97 (d, 2.1) | 09-H | 3.14 (m, br, w1/2 = 25) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.744 (s) | 19-Me | 0.990 (s, br, w1/2 = 4) | 20-H | | 21-Me | 0.956 (d, 6.8) | 22-H | 3.73 (d, br, 10.5) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.238 (s) | 27-Me | 1.243 (s) | [sugar] 1' | 4.53 (d, 8) | [sugar] 2' | 3.29 (dd, 9.1, 8.1) | [sugar] 3' | 3.48 (t, 9.3) | [sugar] 4' | 3.38 (t, 9.3) | [sugar] 5' | 3.45 (m) | [sugar] 6' | 3.70 (dd, 12.4, 6.2) | [sugar] 6'' | 3.89 (dd, 12.3, 2.3) |
|
| |
M.P. | °C ; | [α]D20 | ° (c ; MeOH) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | () ; |
| |
HPLC | NP-HPLC, column Zorbax-SIL 250 x 9.4 mm, solvent CH2Cl2-iPrOH-H2O (125:40:3, v/v/v), flow-rate 4 ml.min-1, Ret. 23.5 min (20E 18.5 min). | GLC | | HPTLC | | TLC | |
| |
| |
|
Permanent link to this datasheet: 2-DEOXYECDYSONE 22-β-D-GLUCOSIDE
|
|