|
|
Year of first isolation: |
1986 |
Formula: | C29H46O6 |
Molecular weight: | 490 |
Occurence in plants: |
Silene scabrifolia [Caryophyllaceae] »
|
Occurence in animals: |
|
|
| |
Canonical SMILES | CC(C1CCC2(C1(CCC3C2=CC(=O)C4C3(CCC(C4)OC(=O)C)C)C)O)C(CCC(C)(C)O)O | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@@H](C[C@H](C1)OC(=O)C)C(=O)C=C1[C@@H]2CC[C@]2([C@]1(CC[C@@H]2[C@H](C)[C@@H](CCC(C)(C)O)O)O)C)C »
| IUPAC Name | [(3S,5R,9R,10R,13R,14S,17R)-17-[(2S,3R)-3,6-dihydroxy-6-methylheptan-2-yl]-14-hydroxy-10,13-dimethyl-6-oxo-2,3,4,5,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate | CAS-RN | | PubChem CID | 162981555 | InChiKey [ ChemIDPlus: search ] | MKHDZPBJZKDHAK-ATVVWJHGSA-N | InChI | InChI=1S/C29H46O6/c1-17(24(31)10-11-26(3,4)33)20-9-14-29(34)22-16-25(32)23-15-19(35-18(2)30)7-12-27(23,5)21(22)8-13-28(20,29)6/h16-17,19-21,23-24,31,33-34H,7-15H2,1-6H3/t17-,19-,20+,21-,23-,24+,27+,28+,29+/m0/s1 |
| |
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | 490 (M)+ (0.2), 473 (2), 454 (27), 444 (2), 439 (2), 412 (3), 397 (2), 384 (3), 379 (4), 374 (25), 356 (27), 341 (31), 327 (27), 326 (34), 305 (27), 281 (7), 276 (8), 275 (6), 267 (7), 266 (7), 251 (27), 217 (27), 216 (27), 215 (17), 99 (100), 81 (65) | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
C5D5N | 01-Ha | | 01-He | | 02-Ha | | 02-He | | 03-He | 4.87 (m) | 04-Ha | | 04-He | | 05-H | | 07-H | 6.00 (s) | 09-H | 3.25 (m) | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | 0.57 (s) | 19-Me | 0.87 (s) | 20-H | | 21-Me | 1.12 (d, 6) | 22-H | 4.00 (m) | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 26-Me | 1.25 (s) | 27-Me | 1.25 (s) | O-Ac | 1.85 (s) |
|
| |
M.P. | 216-218 °C | [α]D20 | 131.9 ? 2 ° (c 0.90; MeOH) | IR (KBr) ν max (cm-1) | 3340-3475, 1665, 1735, 1250 | UV (EtOH) λ max (log ε) | 245 nm (4.00) |
| |
HPTLC | | GLC | | HPLC | | LC | NP column silicagel, solvent CHCl3-MeOH (25:1) |
| |
| |
|
Permanent link to this datasheet: 2-DEOXYECDYSONE 3-ACETATE
|
|