|
|
Year of first isolation: |
1964 |
Formula: | C27H44O4 |
Molecular weight: | 432 |
Occurence in plants: |
Wilcoxia viperina [Cactaceae] » ![Wikipedia: <br />
<b>Warning</b>: preg_replace() [<a href='function.preg-replace'>function.preg-replace</a>]: No ending delimiter '&' found in <b>/usr/local/www/apache22/data/ecdybase.org/www/sheet.inc</b> on line <b>63</b><br />](/images/wikipedia.png)
|
Occurence in animals: |
|
|
|
|
Canonical SMILES | | Isomeric SMILES [ PubChem: search | XML ] [ ChemSpider: search ] | C1[C@]2([C@H](C[C@H](C1)O)C(=O)C=C1[C@@]2(CC[C@]2([C@]1(CC[C@@H]2[C@H](C)CCCC(C)C)O)C)O)C » 
| IUPAC Name | | CAS-RN | | PubChem CID | | InChiKey [ ChemIDPlus: search ] | VLVFQEPKPIFGQX-FRXXJFEDSA-N | InChI | InChI=1S/C27H44O4/c1-17(2)7-6-8-18(3)20-10-12-26(30)23-16-22(29)21-15-19(28)9-11-24(21,4)27(23,31)14-13-25(20,26)5/h16-21,28,30-31H,6-15H2,1-5H3/t18-,19+,20-,21-,24+,25-,26-,27-/m1/s1 |
|
|
CI-MS (NH3) m/z | | EI-MS m/z (relative intensity %) | | HR-MS | |
|
|
C5D5N | 01 | | 02 | | 03 | | 04 | | 05 | | 06 | | 07 | | 08 | | 09 | | 10 | | 11 | | 12 | | 13 | | 14 | | 15 | | 16 | | 17 | | 18 | | 19 | | 20 | | 21 | | 22 | | 23 | | 24 | | 25 | | 26 | | 27 | |
|
CD3OD | 01-Ha | | 01-He | | 02-Ha | | 03-He | | 04-Ha | | 04-He | | 05-H | | 07-H | | 11-Ha | | 11-He | | 12-Ha | | 12-He | | 14-H | | 15-Ha | | 15-Hb | | 16-Ha | | 16-Hb | | 17-H | | 18-Me | | 19-Me | | 20-H | | 21-Me | | 22-H | | 23-Ha | | 23-Hb | | 24-Ha | | 24-Hb | | 25-H | | 26-Me | | 27-Me | |
|
|
|
M.P. | 197-198 °C | [α]D26 | - 20.6 ° (c ; CHCl3) | IR (KBr) ν max (cm-1) | | UV (EtOH) λ max (log ε) | 229 (4.033) |
|
|
|
|
|
|
|
Permanent link to this datasheet: VIPERIDINONE
|